C12H21FN2 — CID 166140821
3-fluoro-6-methyl-1,2,3,4-tetrahydropyridine;6-methyl-1,2,3,4-tetrahydropyridine (PubChem CID 166140821) has the molecular formula C12H21FN2 and a molecular weight of 212.31 g/mol. Its IUPAC name is 3-fluoro-6-methyl-1,2,3,4-tetrahydropyridine;6-methyl-1,2,3,4-tetrahydropyridine.
| Compound Name | 3-fluoro-6-methyl-1,2,3,4-tetrahydropyridine;6-methyl-1,2,3,4-tetrahydropyridine |
|---|---|
| PubChem CID | 166140821 |
| Molecular Formula | C12H21FN2 |
| Molecular Weight | 212.31 g/mol |
| Exact Mass | 212.17 |
| IUPAC Name | 3-fluoro-6-methyl-1,2,3,4-tetrahydropyridine;6-methyl-1,2,3,4-tetrahydropyridine |
| SMILES | CC1=CCC(F)CN1.CC1=CCCCN1 |
| InChI | InChI=1S/C6H10FN.C6H11N/c1-5-2-3-6(7)4-8-5;1-6-4-2-3-5-7-6/h2,6,8H,3-4H2,1H3;4,7H,2-3,5H2,1H3 |
| InChIKey | DYSNXACEINJWMX-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.31 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |