C23H20BClN3O9P — CID 166142620
(3R)-3-[[2-[(5-chloropyridine-2-carbonyl)amino]-2-(4-phosphonophenyl)acetyl]amino]-2-hydroxy-3,4-dihydro-1,2-benzoxaborinine-8-carboxylic acid (PubChem CID 166142620) has the molecular formula C23H20BClN3O9P and a molecular weight of 559.66 g/mol. Its IUPAC name is (3R)-3-[[2-[(5-chloropyridine-2-carbonyl)amino]-2-(4-phosphonophenyl)acetyl]amino]-2-hydroxy-3,4-dihydro-1,2-benzoxaborinine-8-carboxylic acid.
| Compound Name | (3R)-3-[[2-[(5-chloropyridine-2-carbonyl)amino]-2-(4-phosphonophenyl)acetyl]amino]-2-hydroxy-3,4-dihydro-1,2-benzoxaborinine-8-carboxylic acid |
|---|---|
| PubChem CID | 166142620 |
| Molecular Formula | C23H20BClN3O9P |
| Molecular Weight | 559.66 g/mol |
| Exact Mass | 559.07 |
| IUPAC Name | (3R)-3-[[2-[(5-chloropyridine-2-carbonyl)amino]-2-(4-phosphonophenyl)acetyl]amino]-2-hydroxy-3,4-dihydro-1,2-benzoxaborinine-8-carboxylic acid |
| SMILES | O=C(NC(C(=O)N[C@H]1Cc2cccc(C(=O)O)c2OB1O)c1ccc(P(=O)(O)O)cc1)c1ccc(Cl)cn1 |
| InChI | InChI=1S/C23H20BClN3O9P/c25-14-6-9-17(26-11-14)21(29)28-19(12-4-7-15(8-5-12)38(34,35)36)22(30)27-18-10-13-2-1-3-16(23(31)32)20(13)37-24(18)33/h1-9,11,18-19,33H,10H2,(H,27,30)(H,28,29)(H,31,32)(H2,34,35,36)/t18-,19?/m0/s1 |
| InChIKey | JYNQNULYIDDXPR-OYKVQYDMSA-N |
| XLogP | 0.85 |
| TPSA | 195.38 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 559.66 |
| LogP ≤ 5 | 0.85 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|