About 1-[(2-chloro-3,4-dihydroxyphenyl)methyl]-4-methylpiperazine-2,3-dione;ethane
1-[(2-chloro-3,4-dihydroxyphenyl)methyl]-4-methylpiperazine-2,3-dione;ethane (PubChem CID 166142652) has the molecular formula C14H19ClN2O4
and a molecular weight of 314.77 g/mol. Its IUPAC name is 1-[(2-chloro-3,4-dihydroxyphenyl)methyl]-4-methylpiperazine-2,3-dione;ethane.
Molecular Properties
| Compound Name | 1-[(2-chloro-3,4-dihydroxyphenyl)methyl]-4-methylpiperazine-2,3-dione;ethane |
| PubChem CID | 166142652 |
| Molecular Formula | C14H19ClN2O4 |
| Molecular Weight | 314.77 g/mol |
| Exact Mass | 314.10 |
| IUPAC Name | 1-[(2-chloro-3,4-dihydroxyphenyl)methyl]-4-methylpiperazine-2,3-dione;ethane |
| SMILES | CC.CN1CCN(Cc2ccc(O)c(O)c2Cl)C(=O)C1=O |
| InChI | InChI=1S/C12H13ClN2O4.C2H6/c1-14-4-5-15(12(19)11(14)18)6-7-2-3-8(16)10(17)9(7)13;1-2/h2-3,16-17H,4-6H2,1H3;1-2H3 |
| InChIKey | CKMMHMSXIKURJA-UHFFFAOYSA-N |
| XLogP | 1.58 |
| TPSA | 81.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 314.77 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|
Analyze 1-[(2-chloro-3,4-dihydroxyphenyl)methyl]-4-methylpiperazine-2,3-dione;ethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[(2-chloro-3,4-dihydroxyphenyl)methyl]-4-methylpiperazine-2,3-dione;ethane?
The IUPAC name of 1-[(2-chloro-3,4-dihydroxyphenyl)methyl]-4-methylpiperazine-2,3-dione;ethane (CID 166142652) is 1-[(2-chloro-3,4-dihydroxyphenyl)methyl]-4-methylpiperazine-2,3-dione;ethane.
What is the SMILES notation for 1-[(2-chloro-3,4-dihydroxyphenyl)methyl]-4-methylpiperazine-2,3-dione;ethane?
The canonical SMILES for 1-[(2-chloro-3,4-dihydroxyphenyl)methyl]-4-methylpiperazine-2,3-dione;ethane is CC.CN1CCN(Cc2ccc(O)c(O)c2Cl)C(=O)C1=O.
What is the InChIKey of 1-[(2-chloro-3,4-dihydroxyphenyl)methyl]-4-methylpiperazine-2,3-dione;ethane?
The InChIKey is CKMMHMSXIKURJA-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H13ClN2O4.C2H6/c1-14-4-5-15(12(19)11(14)18)6-7-2-3-8(16)10(17)9(7)13;1-2/h2-3,16-17H,4-6H2,1H3;1-2H3.
What are the key properties of 1-[(2-chloro-3,4-dihydroxyphenyl)methyl]-4-methylpiperazine-2,3-dione;ethane?
1-[(2-chloro-3,4-dihydroxyphenyl)methyl]-4-methylpiperazine-2,3-dione;ethane has a molecular weight of 314.77 g/mol, XLogP of 1.58, 2 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[(2-chloro-3,4-dihydroxyphenyl)methyl]-4-methylpiperazine-2,3-dione;ethane is sourced from PubChem (CID 166142652), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).