C33H54O8 — CID 166142941
3,5-bis[5-(2-ethylhexoxy)-5-oxopentoxy]benzoic acid (PubChem CID 166142941) has the molecular formula C33H54O8 and a molecular weight of 578.79 g/mol. Its IUPAC name is 3,5-bis[5-(2-ethylhexoxy)-5-oxopentoxy]benzoic acid.
| Compound Name | 3,5-bis[5-(2-ethylhexoxy)-5-oxopentoxy]benzoic acid |
|---|---|
| PubChem CID | 166142941 |
| Molecular Formula | C33H54O8 |
| Molecular Weight | 578.79 g/mol |
| Exact Mass | 578.38 |
| IUPAC Name | 3,5-bis[5-(2-ethylhexoxy)-5-oxopentoxy]benzoic acid |
| SMILES | CCCCC(CC)COC(=O)CCCCOc1cc(OCCCCC(=O)OCC(CC)CCCC)cc(C(=O)O)c1 |
| InChI | InChI=1S/C33H54O8/c1-5-9-15-26(7-3)24-40-31(34)17-11-13-19-38-29-21-28(33(36)37)22-30(23-29)39-20-14-12-18-32(35)41-25-27(8-4)16-10-6-2/h21-23,26-27H,5-20,24-25H2,1-4H3,(H,36,37) |
| InChIKey | CBNDFINITICVFJ-UHFFFAOYSA-N |
| XLogP | 8.00 |
| TPSA | 108.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 25 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 578.79 |
| LogP ≤ 5 | 8.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|