About N-(cyclohexa-1,3-dien-1-ylmethyl)-1-(1-methylpyrrolidin-2-yl)methanimine
N-(cyclohexa-1,3-dien-1-ylmethyl)-1-(1-methylpyrrolidin-2-yl)methanimine (PubChem CID 166143284) has the molecular formula C13H20N2
and a molecular weight of 204.32 g/mol. Its IUPAC name is N-(cyclohexa-1,3-dien-1-ylmethyl)-1-(1-methylpyrrolidin-2-yl)methanimine.
Molecular Properties
| Compound Name | N-(cyclohexa-1,3-dien-1-ylmethyl)-1-(1-methylpyrrolidin-2-yl)methanimine |
| PubChem CID | 166143284 |
| Molecular Formula | C13H20N2 |
| Molecular Weight | 204.32 g/mol |
| Exact Mass | 204.16 |
| IUPAC Name | N-(cyclohexa-1,3-dien-1-ylmethyl)-1-(1-methylpyrrolidin-2-yl)methanimine |
| SMILES | CN1CCCC1/C=N/CC1=CC=CCC1 |
| InChI | InChI=1S/C13H20N2/c1-15-9-5-8-13(15)11-14-10-12-6-3-2-4-7-12/h2-3,6,11,13H,4-5,7-10H2,1H3/b14-11+ |
| InChIKey | RTIMTIWOGRDOKM-SDNWHVSQSA-N |
| XLogP | 2.43 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 204.32 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze N-(cyclohexa-1,3-dien-1-ylmethyl)-1-(1-methylpyrrolidin-2-yl)methanimine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(cyclohexa-1,3-dien-1-ylmethyl)-1-(1-methylpyrrolidin-2-yl)methanimine?
The IUPAC name of N-(cyclohexa-1,3-dien-1-ylmethyl)-1-(1-methylpyrrolidin-2-yl)methanimine (CID 166143284) is N-(cyclohexa-1,3-dien-1-ylmethyl)-1-(1-methylpyrrolidin-2-yl)methanimine.
What is the SMILES notation for N-(cyclohexa-1,3-dien-1-ylmethyl)-1-(1-methylpyrrolidin-2-yl)methanimine?
The canonical SMILES for N-(cyclohexa-1,3-dien-1-ylmethyl)-1-(1-methylpyrrolidin-2-yl)methanimine is CN1CCCC1/C=N/CC1=CC=CCC1.
What is the InChIKey of N-(cyclohexa-1,3-dien-1-ylmethyl)-1-(1-methylpyrrolidin-2-yl)methanimine?
The InChIKey is RTIMTIWOGRDOKM-SDNWHVSQSA-N. The full InChI is InChI=1S/C13H20N2/c1-15-9-5-8-13(15)11-14-10-12-6-3-2-4-7-12/h2-3,6,11,13H,4-5,7-10H2,1H3/b14-11+.
What are the key properties of N-(cyclohexa-1,3-dien-1-ylmethyl)-1-(1-methylpyrrolidin-2-yl)methanimine?
N-(cyclohexa-1,3-dien-1-ylmethyl)-1-(1-methylpyrrolidin-2-yl)methanimine has a molecular weight of 204.32 g/mol, XLogP of 2.43, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-(cyclohexa-1,3-dien-1-ylmethyl)-1-(1-methylpyrrolidin-2-yl)methanimine is sourced from PubChem (CID 166143284), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).