C9H18N2S — CID 166143943
(E)-N,N-dimethyl-3-pyrrolidin-1-ylsulfanylprop-2-en-1-amine (PubChem CID 166143943) has the molecular formula C9H18N2S and a molecular weight of 186.32 g/mol. Its IUPAC name is (E)-N,N-dimethyl-3-pyrrolidin-1-ylsulfanylprop-2-en-1-amine.
| Compound Name | (E)-N,N-dimethyl-3-pyrrolidin-1-ylsulfanylprop-2-en-1-amine |
|---|---|
| PubChem CID | 166143943 |
| Molecular Formula | C9H18N2S |
| Molecular Weight | 186.32 g/mol |
| Exact Mass | 186.12 |
| IUPAC Name | (E)-N,N-dimethyl-3-pyrrolidin-1-ylsulfanylprop-2-en-1-amine |
| SMILES | CN(C)C/C=C/SN1CCCC1 |
| InChI | InChI=1S/C9H18N2S/c1-10(2)6-5-9-12-11-7-3-4-8-11/h5,9H,3-4,6-8H2,1-2H3/b9-5+ |
| InChIKey | XEIBSJHAJMLPBZ-WEVVVXLNSA-N |
| XLogP | 1.81 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 186.32 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|