About ethane;1-methyl-7λ4-thia-1-azaspiro[3.5]nonane 7-oxide
ethane;1-methyl-7λ4-thia-1-azaspiro[3.5]nonane 7-oxide (PubChem CID 166144595) has the molecular formula C10H21NOS
and a molecular weight of 203.35 g/mol. Its IUPAC name is ethane;1-methyl-7λ4-thia-1-azaspiro[3.5]nonane 7-oxide.
Molecular Properties
| Compound Name | ethane;1-methyl-7λ4-thia-1-azaspiro[3.5]nonane 7-oxide |
| PubChem CID | 166144595 |
| Molecular Formula | C10H21NOS |
| Molecular Weight | 203.35 g/mol |
| Exact Mass | 203.13 |
| IUPAC Name | ethane;1-methyl-7λ4-thia-1-azaspiro[3.5]nonane 7-oxide |
| SMILES | CC.CN1CCC12CCS(=O)CC2 |
| InChI | InChI=1S/C8H15NOS.C2H6/c1-9-5-2-8(9)3-6-11(10)7-4-8;1-2/h2-7H2,1H3;1-2H3 |
| InChIKey | CNEJVCWYOAZYNF-UHFFFAOYSA-N |
| XLogP | 1.63 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 203.35 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze ethane;1-methyl-7λ4-thia-1-azaspiro[3.5]nonane 7-oxide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;1-methyl-7λ4-thia-1-azaspiro[3.5]nonane 7-oxide?
The IUPAC name of ethane;1-methyl-7λ4-thia-1-azaspiro[3.5]nonane 7-oxide (CID 166144595) is ethane;1-methyl-7λ4-thia-1-azaspiro[3.5]nonane 7-oxide.
What is the SMILES notation for ethane;1-methyl-7λ4-thia-1-azaspiro[3.5]nonane 7-oxide?
The canonical SMILES for ethane;1-methyl-7λ4-thia-1-azaspiro[3.5]nonane 7-oxide is CC.CN1CCC12CCS(=O)CC2.
What is the InChIKey of ethane;1-methyl-7λ4-thia-1-azaspiro[3.5]nonane 7-oxide?
The InChIKey is CNEJVCWYOAZYNF-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H15NOS.C2H6/c1-9-5-2-8(9)3-6-11(10)7-4-8;1-2/h2-7H2,1H3;1-2H3.
What are the key properties of ethane;1-methyl-7λ4-thia-1-azaspiro[3.5]nonane 7-oxide?
ethane;1-methyl-7λ4-thia-1-azaspiro[3.5]nonane 7-oxide has a molecular weight of 203.35 g/mol, XLogP of 1.63, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;1-methyl-7λ4-thia-1-azaspiro[3.5]nonane 7-oxide is sourced from PubChem (CID 166144595), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).