C46H62N4O4 — CID 166144643
[3-[2-[5-(1,3,4,6,7,8,9,9a-octahydropyrido[1,2-a]pyrazin-2-yl)-2-(1-methoxyethyl)-3-pyridinyl]-1-ethyl-5-[3-(7-oxoheptyl)phenyl]indol-3-yl]-2,2-dimethylpropyl] acetate (PubChem CID 166144643) has the molecular formula C46H62N4O4 and a molecular weight of 735.03 g/mol. Its IUPAC name is [3-[2-[5-(1,3,4,6,7,8,9,9a-octahydropyrido[1,2-a]pyrazin-2-yl)-2-(1-methoxyethyl)-3-pyridinyl]-1-ethyl-5-[3-(7-oxoheptyl)phenyl]indol-3-yl]-2,2-dimethylpropyl] acetate.
| Compound Name | [3-[2-[5-(1,3,4,6,7,8,9,9a-octahydropyrido[1,2-a]pyrazin-2-yl)-2-(1-methoxyethyl)-3-pyridinyl]-1-ethyl-5-[3-(7-oxoheptyl)phenyl]indol-3-yl]-2,2-dimethylpropyl] acetate |
|---|---|
| PubChem CID | 166144643 |
| Molecular Formula | C46H62N4O4 |
| Molecular Weight | 735.03 g/mol |
| Exact Mass | 734.48 |
| IUPAC Name | [3-[2-[5-(1,3,4,6,7,8,9,9a-octahydropyrido[1,2-a]pyrazin-2-yl)-2-(1-methoxyethyl)-3-pyridinyl]-1-ethyl-5-[3-(7-oxoheptyl)phenyl]indol-3-yl]-2,2-dimethylpropyl] acetate |
| SMILES | CCn1c(-c2cc(N3CCN4CCCCC4C3)cnc2C(C)OC)c(CC(C)(C)COC(C)=O)c2cc(-c3cccc(CCCCCCC=O)c3)ccc21 |
| InChI | InChI=1S/C46H62N4O4/c1-7-50-43-21-20-37(36-18-15-17-35(26-36)16-11-9-8-10-14-25-51)27-40(43)42(29-46(4,5)32-54-34(3)52)45(50)41-28-39(30-47-44(41)33(2)53-6)49-24-23-48-22-13-12-19-38(48)31-49/h15,17-18,20-21,25-28,30,33,38H,7-14,16,19,22-24,29,31-32H2,1-6H3 |
| InChIKey | QBOOEJKOSDRBTH-UHFFFAOYSA-N |
| XLogP | 9.60 |
| TPSA | 76.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 735.03 |
| LogP ≤ 5 | 9.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|