C51H67BN9O7 — CID 166145168
CID 166145168 (PubChem CID 166145168) has the molecular formula C51H67BN9O7 and a molecular weight of 928.96 g/mol.
| Compound Name | CID 166145168 |
|---|---|
| PubChem CID | 166145168 |
| Molecular Formula | C51H67BN9O7 |
| Molecular Weight | 928.96 g/mol |
| Exact Mass | 928.53 |
| IUPAC Name | — |
| SMILES | C=CC(=O)N(C)CCC1CCN(C(=O)N(C)[C@H](C(=O)NC2CC3=NC(=C[B]3)c3ccc4c(c3)c3c(n4CC)-c4cccnc4[C@@H](OC)C3C(C)(C)COC(=O)[C@@H]3CCCN(N3)C2=O)C(C)C)CC1 |
| InChI | InChI=1S/C51H67BN9O7/c1-10-40(62)57(7)23-18-31-19-24-59(25-20-31)50(66)58(8)44(30(3)4)47(63)55-36-27-39-52-28-37(54-39)32-16-17-38-34(26-32)41-42(46(67-9)43-33(14-12-21-53-43)45(41)60(38)11-2)51(5,6)29-68-49(65)35-15-13-22-61(56-35)48(36)64/h10,12,14,16-17,21,26,28,30-31,35-36,42,44,46,56H,1,11,13,15,18-20,22-25,27,29H2,2-9H3,(H,55,63)/t35-,36?,42?,44-,46-/m0/s1 |
| InChIKey | VFBSXDNGJOGDHE-RWXWSIRFSA-N |
| XLogP | 5.70 |
| TPSA | 171.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 68 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 928.96 |
| LogP ≤ 5 | 5.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|