About acetylene;(2-amino-4-methylpent-1-en-3-ylidene)-dimethylazanium;pyrrolidine
acetylene;(2-amino-4-methylpent-1-en-3-ylidene)-dimethylazanium;pyrrolidine (PubChem CID 166145400) has the molecular formula C14H28N3+
and a molecular weight of 238.40 g/mol. Its IUPAC name is acetylene;(2-amino-4-methylpent-1-en-3-ylidene)-dimethylazanium;pyrrolidine.
Molecular Properties
| Compound Name | acetylene;(2-amino-4-methylpent-1-en-3-ylidene)-dimethylazanium;pyrrolidine |
| PubChem CID | 166145400 |
| Molecular Formula | C14H28N3+ |
| Molecular Weight | 238.40 g/mol |
| Exact Mass | 238.23 |
| IUPAC Name | acetylene;(2-amino-4-methylpent-1-en-3-ylidene)-dimethylazanium;pyrrolidine |
| SMILES | C#C.C1CCNC1.C=C(N)C(C(C)C)=[N+](C)C |
| InChI | InChI=1S/C8H17N2.C4H9N.C2H2/c1-6(2)8(7(3)9)10(4)5;1-2-4-5-3-1;1-2/h6H,3,9H2,1-2,4-5H3;5H,1-4H2;1-2H/q+1;; |
| InChIKey | INTGGGJITRUGON-UHFFFAOYSA-N |
| XLogP | 1.45 |
| TPSA | 41.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 238.40 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze acetylene;(2-amino-4-methylpent-1-en-3-ylidene)-dimethylazanium;pyrrolidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of acetylene;(2-amino-4-methylpent-1-en-3-ylidene)-dimethylazanium;pyrrolidine?
The IUPAC name of acetylene;(2-amino-4-methylpent-1-en-3-ylidene)-dimethylazanium;pyrrolidine (CID 166145400) is acetylene;(2-amino-4-methylpent-1-en-3-ylidene)-dimethylazanium;pyrrolidine.
What is the SMILES notation for acetylene;(2-amino-4-methylpent-1-en-3-ylidene)-dimethylazanium;pyrrolidine?
The canonical SMILES for acetylene;(2-amino-4-methylpent-1-en-3-ylidene)-dimethylazanium;pyrrolidine is C#C.C1CCNC1.C=C(N)C(C(C)C)=[N+](C)C.
What is the InChIKey of acetylene;(2-amino-4-methylpent-1-en-3-ylidene)-dimethylazanium;pyrrolidine?
The InChIKey is INTGGGJITRUGON-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H17N2.C4H9N.C2H2/c1-6(2)8(7(3)9)10(4)5;1-2-4-5-3-1;1-2/h6H,3,9H2,1-2,4-5H3;5H,1-4H2;1-2H/q+1;;.
What are the key properties of acetylene;(2-amino-4-methylpent-1-en-3-ylidene)-dimethylazanium;pyrrolidine?
acetylene;(2-amino-4-methylpent-1-en-3-ylidene)-dimethylazanium;pyrrolidine has a molecular weight of 238.40 g/mol, XLogP of 1.45, 2 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for acetylene;(2-amino-4-methylpent-1-en-3-ylidene)-dimethylazanium;pyrrolidine is sourced from PubChem (CID 166145400), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).