C29H28ClF3N6O2S2 — CID 166145660
8-(4-chlorothiophen-2-yl)-4-[(3R)-3,5-dimethyl-4-prop-2-enoylpiperazin-1-yl]-7-(trifluoromethyl)-10-thia-1,3-diazatricyclo[7.4.1.05,14]tetradeca-3,5,7,9(14)-tetraen-2-one;pyrimidine (PubChem CID 166145660) has the molecular formula C29H28ClF3N6O2S2 and a molecular weight of 649.16 g/mol. Its IUPAC name is 8-(4-chlorothiophen-2-yl)-4-[(3R)-3,5-dimethyl-4-prop-2-enoylpiperazin-1-yl]-7-(trifluoromethyl)-10-thia-1,3-diazatricyclo[7.4.1.05,14]tetradeca-3,5,7,9(14)-tetraen-2-one;pyrimidine.
| Compound Name | 8-(4-chlorothiophen-2-yl)-4-[(3R)-3,5-dimethyl-4-prop-2-enoylpiperazin-1-yl]-7-(trifluoromethyl)-10-thia-1,3-diazatricyclo[7.4.1.05,14]tetradeca-3,5,7,9(14)-tetraen-2-one;pyrimidine |
|---|---|
| PubChem CID | 166145660 |
| Molecular Formula | C29H28ClF3N6O2S2 |
| Molecular Weight | 649.16 g/mol |
| Exact Mass | 648.14 |
| IUPAC Name | 8-(4-chlorothiophen-2-yl)-4-[(3R)-3,5-dimethyl-4-prop-2-enoylpiperazin-1-yl]-7-(trifluoromethyl)-10-thia-1,3-diazatricyclo[7.4.1.05,14]tetradeca-3,5,7,9(14)-tetraen-2-one;pyrimidine |
| SMILES | C=CC(=O)N1C(C)CN(c2nc(=O)n3c4c(c(-c5cc(Cl)cs5)c(C(F)(F)F)cc24)SCCC3)C[C@H]1C.c1cncnc1 |
| InChI | InChI=1S/C25H24ClF3N4O2S2.C4H4N2/c1-4-19(34)33-13(2)10-31(11-14(33)3)23-16-9-17(25(27,28)29)20(18-8-15(26)12-37-18)22-21(16)32(24(35)30-23)6-5-7-36-22;1-2-5-4-6-3-1/h4,8-9,12-14H,1,5-7,10-11H2,2-3H3;1-4H/t13-,14?;/m1./s1 |
| InChIKey | LBKZRYQFCCGHFI-JRLNIEDVSA-N |
| XLogP | 6.38 |
| TPSA | 84.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 649.16 |
| LogP ≤ 5 | 6.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|