About (6-chlorothieno[3,2-c]pyridin-2-yl)-trimethylstannane
(6-chlorothieno[3,2-c]pyridin-2-yl)-trimethylstannane (PubChem CID 166146158) has the molecular formula C10H12ClNSSn
and a molecular weight of 332.44 g/mol. Its IUPAC name is (6-chlorothieno[3,2-c]pyridin-2-yl)-trimethylstannane.
Molecular Properties
| Compound Name | (6-chlorothieno[3,2-c]pyridin-2-yl)-trimethylstannane |
| PubChem CID | 166146158 |
| Molecular Formula | C10H12ClNSSn |
| Molecular Weight | 332.44 g/mol |
| Exact Mass | 332.94 |
| IUPAC Name | (6-chlorothieno[3,2-c]pyridin-2-yl)-trimethylstannane |
| SMILES | C[Sn](C)(C)c1cc2cnc(Cl)cc2s1 |
| InChI | InChI=1S/C7H3ClNS.3CH3.Sn/c8-7-3-6-5(4-9-7)1-2-10-6;;;;/h1,3-4H;3*1H3; |
| InChIKey | HKCPULBFDUBICM-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 332.44 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|
Analyze (6-chlorothieno[3,2-c]pyridin-2-yl)-trimethylstannane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (6-chlorothieno[3,2-c]pyridin-2-yl)-trimethylstannane?
The IUPAC name of (6-chlorothieno[3,2-c]pyridin-2-yl)-trimethylstannane (CID 166146158) is (6-chlorothieno[3,2-c]pyridin-2-yl)-trimethylstannane.
What is the SMILES notation for (6-chlorothieno[3,2-c]pyridin-2-yl)-trimethylstannane?
The canonical SMILES for (6-chlorothieno[3,2-c]pyridin-2-yl)-trimethylstannane is C[Sn](C)(C)c1cc2cnc(Cl)cc2s1.
What is the InChIKey of (6-chlorothieno[3,2-c]pyridin-2-yl)-trimethylstannane?
The InChIKey is HKCPULBFDUBICM-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H3ClNS.3CH3.Sn/c8-7-3-6-5(4-9-7)1-2-10-6;;;;/h1,3-4H;3*1H3;.
What are the key properties of (6-chlorothieno[3,2-c]pyridin-2-yl)-trimethylstannane?
(6-chlorothieno[3,2-c]pyridin-2-yl)-trimethylstannane has a molecular weight of 332.44 g/mol, XLogP of 3.49, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (6-chlorothieno[3,2-c]pyridin-2-yl)-trimethylstannane is sourced from PubChem (CID 166146158), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).