About 2-azaspiro[3.5]non-6-ene
2-azaspiro[3.5]non-6-ene (PubChem CID 166146401) has the molecular formula C8H13N
and a molecular weight of 123.20 g/mol. Its IUPAC name is 2-azaspiro[3.5]non-6-ene.
Molecular Properties
| Compound Name | 2-azaspiro[3.5]non-6-ene |
| PubChem CID | 166146401 |
| Molecular Formula | C8H13N |
| Molecular Weight | 123.20 g/mol |
| Exact Mass | 123.10 |
| IUPAC Name | 2-azaspiro[3.5]non-6-ene |
| SMILES | C1=CCC2(CC1)CNC2 |
| InChI | InChI=1S/C8H13N/c1-2-4-8(5-3-1)6-9-7-8/h1-2,9H,3-7H2 |
| InChIKey | FVOMBGNMMUVCCV-UHFFFAOYSA-N |
| XLogP | 1.32 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 123.20 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 2-azaspiro[3.5]non-6-ene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-azaspiro[3.5]non-6-ene?
The IUPAC name of 2-azaspiro[3.5]non-6-ene (CID 166146401) is 2-azaspiro[3.5]non-6-ene.
What is the SMILES notation for 2-azaspiro[3.5]non-6-ene?
The canonical SMILES for 2-azaspiro[3.5]non-6-ene is C1=CCC2(CC1)CNC2.
What is the InChIKey of 2-azaspiro[3.5]non-6-ene?
The InChIKey is FVOMBGNMMUVCCV-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H13N/c1-2-4-8(5-3-1)6-9-7-8/h1-2,9H,3-7H2.
What are the key properties of 2-azaspiro[3.5]non-6-ene?
2-azaspiro[3.5]non-6-ene has a molecular weight of 123.20 g/mol, XLogP of 1.32, 0 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-azaspiro[3.5]non-6-ene is sourced from PubChem (CID 166146401), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).