About ethane;2-methylidene-5-propan-2-yl-1-(3,3,3-trifluoroprop-1-en-2-yl)pyridine
ethane;2-methylidene-5-propan-2-yl-1-(3,3,3-trifluoroprop-1-en-2-yl)pyridine (PubChem CID 166146543) has the molecular formula C14H20F3N
and a molecular weight of 259.31 g/mol. Its IUPAC name is ethane;2-methylidene-5-propan-2-yl-1-(3,3,3-trifluoroprop-1-en-2-yl)pyridine.
Molecular Properties
| Compound Name | ethane;2-methylidene-5-propan-2-yl-1-(3,3,3-trifluoroprop-1-en-2-yl)pyridine |
| PubChem CID | 166146543 |
| Molecular Formula | C14H20F3N |
| Molecular Weight | 259.31 g/mol |
| Exact Mass | 259.15 |
| IUPAC Name | ethane;2-methylidene-5-propan-2-yl-1-(3,3,3-trifluoroprop-1-en-2-yl)pyridine |
| SMILES | C=C1C=CC(C(C)C)=CN1C(=C)C(F)(F)F.CC |
| InChI | InChI=1S/C12H14F3N.C2H6/c1-8(2)11-6-5-9(3)16(7-11)10(4)12(13,14)15;1-2/h5-8H,3-4H2,1-2H3;1-2H3 |
| InChIKey | DUZICVVDZKOLDR-UHFFFAOYSA-N |
| XLogP | 5.01 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 259.31 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze ethane;2-methylidene-5-propan-2-yl-1-(3,3,3-trifluoroprop-1-en-2-yl)pyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;2-methylidene-5-propan-2-yl-1-(3,3,3-trifluoroprop-1-en-2-yl)pyridine?
The IUPAC name of ethane;2-methylidene-5-propan-2-yl-1-(3,3,3-trifluoroprop-1-en-2-yl)pyridine (CID 166146543) is ethane;2-methylidene-5-propan-2-yl-1-(3,3,3-trifluoroprop-1-en-2-yl)pyridine.
What is the SMILES notation for ethane;2-methylidene-5-propan-2-yl-1-(3,3,3-trifluoroprop-1-en-2-yl)pyridine?
The canonical SMILES for ethane;2-methylidene-5-propan-2-yl-1-(3,3,3-trifluoroprop-1-en-2-yl)pyridine is C=C1C=CC(C(C)C)=CN1C(=C)C(F)(F)F.CC.
What is the InChIKey of ethane;2-methylidene-5-propan-2-yl-1-(3,3,3-trifluoroprop-1-en-2-yl)pyridine?
The InChIKey is DUZICVVDZKOLDR-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H14F3N.C2H6/c1-8(2)11-6-5-9(3)16(7-11)10(4)12(13,14)15;1-2/h5-8H,3-4H2,1-2H3;1-2H3.
What are the key properties of ethane;2-methylidene-5-propan-2-yl-1-(3,3,3-trifluoroprop-1-en-2-yl)pyridine?
ethane;2-methylidene-5-propan-2-yl-1-(3,3,3-trifluoroprop-1-en-2-yl)pyridine has a molecular weight of 259.31 g/mol, XLogP of 5.01, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;2-methylidene-5-propan-2-yl-1-(3,3,3-trifluoroprop-1-en-2-yl)pyridine is sourced from PubChem (CID 166146543), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).