About (2-methyl-[1,3]thiazolo[5,4-b]pyridin-5-yl)boronic acid
(2-methyl-[1,3]thiazolo[5,4-b]pyridin-5-yl)boronic acid (PubChem CID 166146576) has the molecular formula C7H7BN2O2S
and a molecular weight of 194.02 g/mol. Its IUPAC name is (2-methyl-[1,3]thiazolo[5,4-b]pyridin-5-yl)boronic acid.
Molecular Properties
| Compound Name | (2-methyl-[1,3]thiazolo[5,4-b]pyridin-5-yl)boronic acid |
| PubChem CID | 166146576 |
| Molecular Formula | C7H7BN2O2S |
| Molecular Weight | 194.02 g/mol |
| Exact Mass | 194.03 |
| IUPAC Name | (2-methyl-[1,3]thiazolo[5,4-b]pyridin-5-yl)boronic acid |
| SMILES | Cc1nc2ccc(B(O)O)nc2s1 |
| InChI | InChI=1S/C7H7BN2O2S/c1-4-9-5-2-3-6(8(11)12)10-7(5)13-4/h2-3,11-12H,1H3 |
| InChIKey | VDOOSJXLUAERRM-UHFFFAOYSA-N |
| XLogP | -0.32 |
| TPSA | 66.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 194.02 |
| LogP ≤ 5 | -0.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze (2-methyl-[1,3]thiazolo[5,4-b]pyridin-5-yl)boronic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2-methyl-[1,3]thiazolo[5,4-b]pyridin-5-yl)boronic acid?
The IUPAC name of (2-methyl-[1,3]thiazolo[5,4-b]pyridin-5-yl)boronic acid (CID 166146576) is (2-methyl-[1,3]thiazolo[5,4-b]pyridin-5-yl)boronic acid.
What is the SMILES notation for (2-methyl-[1,3]thiazolo[5,4-b]pyridin-5-yl)boronic acid?
The canonical SMILES for (2-methyl-[1,3]thiazolo[5,4-b]pyridin-5-yl)boronic acid is Cc1nc2ccc(B(O)O)nc2s1.
What is the InChIKey of (2-methyl-[1,3]thiazolo[5,4-b]pyridin-5-yl)boronic acid?
The InChIKey is VDOOSJXLUAERRM-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H7BN2O2S/c1-4-9-5-2-3-6(8(11)12)10-7(5)13-4/h2-3,11-12H,1H3.
What are the key properties of (2-methyl-[1,3]thiazolo[5,4-b]pyridin-5-yl)boronic acid?
(2-methyl-[1,3]thiazolo[5,4-b]pyridin-5-yl)boronic acid has a molecular weight of 194.02 g/mol, XLogP of -0.32, 1 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (2-methyl-[1,3]thiazolo[5,4-b]pyridin-5-yl)boronic acid is sourced from PubChem (CID 166146576), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).