About 2-ethenyl-1-methyl-4-propan-2-ylbenzene;2-methylpentan-2-ol
2-ethenyl-1-methyl-4-propan-2-ylbenzene;2-methylpentan-2-ol (PubChem CID 166146990) has the molecular formula C18H30O
and a molecular weight of 262.44 g/mol. Its IUPAC name is 2-ethenyl-1-methyl-4-propan-2-ylbenzene;2-methylpentan-2-ol.
Molecular Properties
| Compound Name | 2-ethenyl-1-methyl-4-propan-2-ylbenzene;2-methylpentan-2-ol |
| PubChem CID | 166146990 |
| Molecular Formula | C18H30O |
| Molecular Weight | 262.44 g/mol |
| Exact Mass | 262.23 |
| IUPAC Name | 2-ethenyl-1-methyl-4-propan-2-ylbenzene;2-methylpentan-2-ol |
| SMILES | C=Cc1cc(C(C)C)ccc1C.CCCC(C)(C)O |
| InChI | InChI=1S/C12H16.C6H14O/c1-5-11-8-12(9(2)3)7-6-10(11)4;1-4-5-6(2,3)7/h5-9H,1H2,2-4H3;7H,4-5H2,1-3H3 |
| InChIKey | GSQRELLXUAUZLS-UHFFFAOYSA-N |
| XLogP | 5.32 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 262.44 |
| LogP ≤ 5 | 5.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 2-ethenyl-1-methyl-4-propan-2-ylbenzene;2-methylpentan-2-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-ethenyl-1-methyl-4-propan-2-ylbenzene;2-methylpentan-2-ol?
The IUPAC name of 2-ethenyl-1-methyl-4-propan-2-ylbenzene;2-methylpentan-2-ol (CID 166146990) is 2-ethenyl-1-methyl-4-propan-2-ylbenzene;2-methylpentan-2-ol.
What is the SMILES notation for 2-ethenyl-1-methyl-4-propan-2-ylbenzene;2-methylpentan-2-ol?
The canonical SMILES for 2-ethenyl-1-methyl-4-propan-2-ylbenzene;2-methylpentan-2-ol is C=Cc1cc(C(C)C)ccc1C.CCCC(C)(C)O.
What is the InChIKey of 2-ethenyl-1-methyl-4-propan-2-ylbenzene;2-methylpentan-2-ol?
The InChIKey is GSQRELLXUAUZLS-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H16.C6H14O/c1-5-11-8-12(9(2)3)7-6-10(11)4;1-4-5-6(2,3)7/h5-9H,1H2,2-4H3;7H,4-5H2,1-3H3.
What are the key properties of 2-ethenyl-1-methyl-4-propan-2-ylbenzene;2-methylpentan-2-ol?
2-ethenyl-1-methyl-4-propan-2-ylbenzene;2-methylpentan-2-ol has a molecular weight of 262.44 g/mol, XLogP of 5.32, 4 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-ethenyl-1-methyl-4-propan-2-ylbenzene;2-methylpentan-2-ol is sourced from PubChem (CID 166146990), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).