C28H27N3O4 — CID 166147047
methyl 2-[1-[2-(3,4-dimethanimidoylphenyl)-6-methyl-4-oxochromen-8-yl]ethylamino]benzoate;molecular hydrogen (PubChem CID 166147047) has the molecular formula C28H27N3O4 and a molecular weight of 469.54 g/mol. Its IUPAC name is methyl 2-[1-[2-(3,4-dimethanimidoylphenyl)-6-methyl-4-oxochromen-8-yl]ethylamino]benzoate;molecular hydrogen.
| Compound Name | methyl 2-[1-[2-(3,4-dimethanimidoylphenyl)-6-methyl-4-oxochromen-8-yl]ethylamino]benzoate;molecular hydrogen |
|---|---|
| PubChem CID | 166147047 |
| Molecular Formula | C28H27N3O4 |
| Molecular Weight | 469.54 g/mol |
| Exact Mass | 469.20 |
| IUPAC Name | methyl 2-[1-[2-(3,4-dimethanimidoylphenyl)-6-methyl-4-oxochromen-8-yl]ethylamino]benzoate;molecular hydrogen |
| SMILES | [H]/N=C/c1ccc(-c2cc(=O)c3cc(C)cc(C(C)Nc4ccccc4C(=O)OC)c3o2)cc1/C=N/[H].[H][H] |
| InChI | InChI=1S/C28H25N3O4.H2/c1-16-10-22(17(2)31-24-7-5-4-6-21(24)28(33)34-3)27-23(11-16)25(32)13-26(35-27)18-8-9-19(14-29)20(12-18)15-30;/h4-15,17,29-31H,1-3H3;1H/b29-14+,30-15+; |
| InChIKey | WRGXNVHYKKIAPM-ZKAHEHLSSA-N |
| XLogP | 5.97 |
| TPSA | 116.24 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.54 |
| LogP ≤ 5 | 5.97 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|