C13H16N4O3 — CID 166147588
2-methyl-6-piperidin-4-yl-3H-pyrido[3,4-d]pyridazine-1,4,7-trione (PubChem CID 166147588) has the molecular formula C13H16N4O3 and a molecular weight of 276.30 g/mol. Its IUPAC name is 2-methyl-6-piperidin-4-yl-3H-pyrido[3,4-d]pyridazine-1,4,7-trione.
| Compound Name | 2-methyl-6-piperidin-4-yl-3H-pyrido[3,4-d]pyridazine-1,4,7-trione |
|---|---|
| PubChem CID | 166147588 |
| Molecular Formula | C13H16N4O3 |
| Molecular Weight | 276.30 g/mol |
| Exact Mass | 276.12 |
| IUPAC Name | 2-methyl-6-piperidin-4-yl-3H-pyrido[3,4-d]pyridazine-1,4,7-trione |
| SMILES | Cn1[nH]c(=O)c2cn(C3CCNCC3)c(=O)cc2c1=O |
| InChI | InChI=1S/C13H16N4O3/c1-16-13(20)9-6-11(18)17(7-10(9)12(19)15-16)8-2-4-14-5-3-8/h6-8,14H,2-5H2,1H3,(H,15,19) |
| InChIKey | XEDNBLIYXGBXPP-UHFFFAOYSA-N |
| XLogP | -0.69 |
| TPSA | 88.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.30 |
| LogP ≤ 5 | -0.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |