C19H18N6O — CID 166147987
5-[[5-(2-cyclopentyloxyphenyl)-1H-pyrazol-3-yl]amino]pyrazine-2-carbonitrile (PubChem CID 166147987) has the molecular formula C19H18N6O and a molecular weight of 346.39 g/mol. Its IUPAC name is 5-[[5-(2-cyclopentyloxyphenyl)-1H-pyrazol-3-yl]amino]pyrazine-2-carbonitrile.
| Compound Name | 5-[[5-(2-cyclopentyloxyphenyl)-1H-pyrazol-3-yl]amino]pyrazine-2-carbonitrile |
|---|---|
| PubChem CID | 166147987 |
| Molecular Formula | C19H18N6O |
| Molecular Weight | 346.39 g/mol |
| Exact Mass | 346.15 |
| IUPAC Name | 5-[[5-(2-cyclopentyloxyphenyl)-1H-pyrazol-3-yl]amino]pyrazine-2-carbonitrile |
| SMILES | N#Cc1cnc(Nc2cc(-c3ccccc3OC3CCCC3)[nH]n2)cn1 |
| InChI | InChI=1S/C19H18N6O/c20-10-13-11-22-19(12-21-13)23-18-9-16(24-25-18)15-7-3-4-8-17(15)26-14-5-1-2-6-14/h3-4,7-9,11-12,14H,1-2,5-6H2,(H2,22,23,24,25) |
| InChIKey | CMNYYULCVLJCBG-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 99.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.39 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |