About 4-(difluoromethyl)-5H-1,3-oxazol-2-one
4-(difluoromethyl)-5H-1,3-oxazol-2-one (PubChem CID 166148113) has the molecular formula C4H3F2NO2
and a molecular weight of 135.07 g/mol. Its IUPAC name is 4-(difluoromethyl)-5H-1,3-oxazol-2-one.
Molecular Properties
| Compound Name | 4-(difluoromethyl)-5H-1,3-oxazol-2-one |
| PubChem CID | 166148113 |
| Molecular Formula | C4H3F2NO2 |
| Molecular Weight | 135.07 g/mol |
| Exact Mass | 135.01 |
| IUPAC Name | 4-(difluoromethyl)-5H-1,3-oxazol-2-one |
| SMILES | O=C1N=C(C(F)F)CO1 |
| InChI | InChI=1S/C4H3F2NO2/c5-3(6)2-1-9-4(8)7-2/h3H,1H2 |
| InChIKey | NZAVEQRBZIBHOG-UHFFFAOYSA-N |
| XLogP | 0.84 |
| TPSA | 38.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 135.07 |
| LogP ≤ 5 | 0.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 4-(difluoromethyl)-5H-1,3-oxazol-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(difluoromethyl)-5H-1,3-oxazol-2-one?
The IUPAC name of 4-(difluoromethyl)-5H-1,3-oxazol-2-one (CID 166148113) is 4-(difluoromethyl)-5H-1,3-oxazol-2-one.
What is the SMILES notation for 4-(difluoromethyl)-5H-1,3-oxazol-2-one?
The canonical SMILES for 4-(difluoromethyl)-5H-1,3-oxazol-2-one is O=C1N=C(C(F)F)CO1.
What is the InChIKey of 4-(difluoromethyl)-5H-1,3-oxazol-2-one?
The InChIKey is NZAVEQRBZIBHOG-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H3F2NO2/c5-3(6)2-1-9-4(8)7-2/h3H,1H2.
What are the key properties of 4-(difluoromethyl)-5H-1,3-oxazol-2-one?
4-(difluoromethyl)-5H-1,3-oxazol-2-one has a molecular weight of 135.07 g/mol, XLogP of 0.84, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(difluoromethyl)-5H-1,3-oxazol-2-one is sourced from PubChem (CID 166148113), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).