About N-(2,2-difluoro-1-methoxyethyl)-2-methylpropane-2-sulfinamide;ethane
N-(2,2-difluoro-1-methoxyethyl)-2-methylpropane-2-sulfinamide;ethane (PubChem CID 166148121) has the molecular formula C9H21F2NO2S
and a molecular weight of 245.33 g/mol. Its IUPAC name is N-(2,2-difluoro-1-methoxyethyl)-2-methylpropane-2-sulfinamide;ethane.
Molecular Properties
| Compound Name | N-(2,2-difluoro-1-methoxyethyl)-2-methylpropane-2-sulfinamide;ethane |
| PubChem CID | 166148121 |
| Molecular Formula | C9H21F2NO2S |
| Molecular Weight | 245.33 g/mol |
| Exact Mass | 245.13 |
| IUPAC Name | N-(2,2-difluoro-1-methoxyethyl)-2-methylpropane-2-sulfinamide;ethane |
| SMILES | CC.COC(NS(=O)C(C)(C)C)C(F)F |
| InChI | InChI=1S/C7H15F2NO2S.C2H6/c1-7(2,3)13(11)10-6(12-4)5(8)9;1-2/h5-6,10H,1-4H3;1-2H3 |
| InChIKey | QYDYCWYRRGNAHR-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 245.33 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze N-(2,2-difluoro-1-methoxyethyl)-2-methylpropane-2-sulfinamide;ethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(2,2-difluoro-1-methoxyethyl)-2-methylpropane-2-sulfinamide;ethane?
The IUPAC name of N-(2,2-difluoro-1-methoxyethyl)-2-methylpropane-2-sulfinamide;ethane (CID 166148121) is N-(2,2-difluoro-1-methoxyethyl)-2-methylpropane-2-sulfinamide;ethane.
What is the SMILES notation for N-(2,2-difluoro-1-methoxyethyl)-2-methylpropane-2-sulfinamide;ethane?
The canonical SMILES for N-(2,2-difluoro-1-methoxyethyl)-2-methylpropane-2-sulfinamide;ethane is CC.COC(NS(=O)C(C)(C)C)C(F)F.
What is the InChIKey of N-(2,2-difluoro-1-methoxyethyl)-2-methylpropane-2-sulfinamide;ethane?
The InChIKey is QYDYCWYRRGNAHR-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H15F2NO2S.C2H6/c1-7(2,3)13(11)10-6(12-4)5(8)9;1-2/h5-6,10H,1-4H3;1-2H3.
What are the key properties of N-(2,2-difluoro-1-methoxyethyl)-2-methylpropane-2-sulfinamide;ethane?
N-(2,2-difluoro-1-methoxyethyl)-2-methylpropane-2-sulfinamide;ethane has a molecular weight of 245.33 g/mol, XLogP of 2.30, 4 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-(2,2-difluoro-1-methoxyethyl)-2-methylpropane-2-sulfinamide;ethane is sourced from PubChem (CID 166148121), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).