C28H49N4O6+ — CID 166148898
(1-methoxy-2,2,6,6-tetramethylpiperidin-4-yl) 3-[3-[3-(1-hydroxy-2,2,6,6-tetramethylpiperidin-4-yl)oxy-3-oxopropyl]imidazol-3-ium-1-yl]propanoate (PubChem CID 166148898) has the molecular formula C28H49N4O6+ and a molecular weight of 537.72 g/mol. Its IUPAC name is (1-methoxy-2,2,6,6-tetramethylpiperidin-4-yl) 3-[3-[3-(1-hydroxy-2,2,6,6-tetramethylpiperidin-4-yl)oxy-3-oxopropyl]imidazol-3-ium-1-yl]propanoate.
| Compound Name | (1-methoxy-2,2,6,6-tetramethylpiperidin-4-yl) 3-[3-[3-(1-hydroxy-2,2,6,6-tetramethylpiperidin-4-yl)oxy-3-oxopropyl]imidazol-3-ium-1-yl]propanoate |
|---|---|
| PubChem CID | 166148898 |
| Molecular Formula | C28H49N4O6+ |
| Molecular Weight | 537.72 g/mol |
| Exact Mass | 537.36 |
| IUPAC Name | (1-methoxy-2,2,6,6-tetramethylpiperidin-4-yl) 3-[3-[3-(1-hydroxy-2,2,6,6-tetramethylpiperidin-4-yl)oxy-3-oxopropyl]imidazol-3-ium-1-yl]propanoate |
| SMILES | CON1C(C)(C)CC(OC(=O)CCn2cc[n+](CCC(=O)OC3CC(C)(C)N(O)C(C)(C)C3)c2)CC1(C)C |
| InChI | InChI=1S/C28H49N4O6/c1-25(2)16-21(17-26(3,4)31(25)35)37-23(33)10-12-29-14-15-30(20-29)13-11-24(34)38-22-18-27(5,6)32(36-9)28(7,8)19-22/h14-15,20-22,35H,10-13,16-19H2,1-9H3/q+1 |
| InChIKey | MVZSTJIKEUEQPX-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 97.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 537.72 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|