C27H51N4O4+ — CID 166148904
1-hydroxy-4-[3-[3-[3-(1-hydroxy-2,2,6,6-tetramethylpiperidin-4-yl)oxypropyl]imidazol-1-ium-1-yl]propoxy]-2,2,6,6-tetramethylpiperidine (PubChem CID 166148904) has the molecular formula C27H51N4O4+ and a molecular weight of 495.73 g/mol. Its IUPAC name is 1-hydroxy-4-[3-[3-[3-(1-hydroxy-2,2,6,6-tetramethylpiperidin-4-yl)oxypropyl]imidazol-1-ium-1-yl]propoxy]-2,2,6,6-tetramethylpiperidine.
| Compound Name | 1-hydroxy-4-[3-[3-[3-(1-hydroxy-2,2,6,6-tetramethylpiperidin-4-yl)oxypropyl]imidazol-1-ium-1-yl]propoxy]-2,2,6,6-tetramethylpiperidine |
|---|---|
| PubChem CID | 166148904 |
| Molecular Formula | C27H51N4O4+ |
| Molecular Weight | 495.73 g/mol |
| Exact Mass | 495.39 |
| IUPAC Name | 1-hydroxy-4-[3-[3-[3-(1-hydroxy-2,2,6,6-tetramethylpiperidin-4-yl)oxypropyl]imidazol-1-ium-1-yl]propoxy]-2,2,6,6-tetramethylpiperidine |
| SMILES | CC1(C)CC(OCCCn2cc[n+](CCCOC3CC(C)(C)N(O)C(C)(C)C3)c2)CC(C)(C)N1O |
| InChI | InChI=1S/C27H51N4O4/c1-24(2)17-22(18-25(3,4)30(24)32)34-15-9-11-28-13-14-29(21-28)12-10-16-35-23-19-26(5,6)31(33)27(7,8)20-23/h13-14,21-23,32-33H,9-12,15-20H2,1-8H3/q+1 |
| InChIKey | IDBUCNVHHJQYHV-UHFFFAOYSA-N |
| XLogP | 4.41 |
| TPSA | 74.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.73 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|