C21H39N4O2+ — CID 166148935
1-hydroxy-4-[3-(1-hydroxy-2,2,6,6-tetramethylpiperidin-4-yl)imidazol-1-ium-1-yl]-2,2,6,6-tetramethylpiperidine (PubChem CID 166148935) has the molecular formula C21H39N4O2+ and a molecular weight of 379.57 g/mol. Its IUPAC name is 1-hydroxy-4-[3-(1-hydroxy-2,2,6,6-tetramethylpiperidin-4-yl)imidazol-1-ium-1-yl]-2,2,6,6-tetramethylpiperidine.
| Compound Name | 1-hydroxy-4-[3-(1-hydroxy-2,2,6,6-tetramethylpiperidin-4-yl)imidazol-1-ium-1-yl]-2,2,6,6-tetramethylpiperidine |
|---|---|
| PubChem CID | 166148935 |
| Molecular Formula | C21H39N4O2+ |
| Molecular Weight | 379.57 g/mol |
| Exact Mass | 379.31 |
| IUPAC Name | 1-hydroxy-4-[3-(1-hydroxy-2,2,6,6-tetramethylpiperidin-4-yl)imidazol-1-ium-1-yl]-2,2,6,6-tetramethylpiperidine |
| SMILES | CC1(C)CC(n2cc[n+](C3CC(C)(C)N(O)C(C)(C)C3)c2)CC(C)(C)N1O |
| InChI | InChI=1S/C21H39N4O2/c1-18(2)11-16(12-19(3,4)24(18)26)22-9-10-23(15-22)17-13-20(5,6)25(27)21(7,8)14-17/h9-10,15-17,26-27H,11-14H2,1-8H3/q+1 |
| InChIKey | NXQKQLNZMNXAKF-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 55.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.57 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|