About (Z)-6-(4-ethenyl-2,3-dihydrofuran-5-yl)-N-methylhex-5-en-2-amine
(Z)-6-(4-ethenyl-2,3-dihydrofuran-5-yl)-N-methylhex-5-en-2-amine (PubChem CID 166149287) has the molecular formula C13H21NO
and a molecular weight of 207.32 g/mol. Its IUPAC name is (Z)-6-(4-ethenyl-2,3-dihydrofuran-5-yl)-N-methylhex-5-en-2-amine.
Molecular Properties
| Compound Name | (Z)-6-(4-ethenyl-2,3-dihydrofuran-5-yl)-N-methylhex-5-en-2-amine |
| PubChem CID | 166149287 |
| Molecular Formula | C13H21NO |
| Molecular Weight | 207.32 g/mol |
| Exact Mass | 207.16 |
| IUPAC Name | (Z)-6-(4-ethenyl-2,3-dihydrofuran-5-yl)-N-methylhex-5-en-2-amine |
| SMILES | C=CC1=C(/C=C\CCC(C)NC)OCC1 |
| InChI | InChI=1S/C13H21NO/c1-4-12-9-10-15-13(12)8-6-5-7-11(2)14-3/h4,6,8,11,14H,1,5,7,9-10H2,2-3H3/b8-6- |
| InChIKey | BCAHBVWLLNNYFG-VURMDHGXSA-N |
| XLogP | 2.79 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 207.32 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze (Z)-6-(4-ethenyl-2,3-dihydrofuran-5-yl)-N-methylhex-5-en-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (Z)-6-(4-ethenyl-2,3-dihydrofuran-5-yl)-N-methylhex-5-en-2-amine?
The IUPAC name of (Z)-6-(4-ethenyl-2,3-dihydrofuran-5-yl)-N-methylhex-5-en-2-amine (CID 166149287) is (Z)-6-(4-ethenyl-2,3-dihydrofuran-5-yl)-N-methylhex-5-en-2-amine.
What is the SMILES notation for (Z)-6-(4-ethenyl-2,3-dihydrofuran-5-yl)-N-methylhex-5-en-2-amine?
The canonical SMILES for (Z)-6-(4-ethenyl-2,3-dihydrofuran-5-yl)-N-methylhex-5-en-2-amine is C=CC1=C(/C=C\CCC(C)NC)OCC1.
What is the InChIKey of (Z)-6-(4-ethenyl-2,3-dihydrofuran-5-yl)-N-methylhex-5-en-2-amine?
The InChIKey is BCAHBVWLLNNYFG-VURMDHGXSA-N. The full InChI is InChI=1S/C13H21NO/c1-4-12-9-10-15-13(12)8-6-5-7-11(2)14-3/h4,6,8,11,14H,1,5,7,9-10H2,2-3H3/b8-6-.
What are the key properties of (Z)-6-(4-ethenyl-2,3-dihydrofuran-5-yl)-N-methylhex-5-en-2-amine?
(Z)-6-(4-ethenyl-2,3-dihydrofuran-5-yl)-N-methylhex-5-en-2-amine has a molecular weight of 207.32 g/mol, XLogP of 2.79, 6 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (Z)-6-(4-ethenyl-2,3-dihydrofuran-5-yl)-N-methylhex-5-en-2-amine is sourced from PubChem (CID 166149287), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).