C20H23N5O — CID 166151232
5-methyl-2-[4-[[(3R)-1-methylpiperidin-3-yl]amino]phthalazin-1-yl]pyridin-3-ol (PubChem CID 166151232) has the molecular formula C20H23N5O and a molecular weight of 349.44 g/mol. Its IUPAC name is 5-methyl-2-[4-[[(3R)-1-methylpiperidin-3-yl]amino]phthalazin-1-yl]pyridin-3-ol.
| Compound Name | 5-methyl-2-[4-[[(3R)-1-methylpiperidin-3-yl]amino]phthalazin-1-yl]pyridin-3-ol |
|---|---|
| PubChem CID | 166151232 |
| Molecular Formula | C20H23N5O |
| Molecular Weight | 349.44 g/mol |
| Exact Mass | 349.19 |
| IUPAC Name | 5-methyl-2-[4-[[(3R)-1-methylpiperidin-3-yl]amino]phthalazin-1-yl]pyridin-3-ol |
| SMILES | Cc1cnc(-c2nnc(N[C@@H]3CCCN(C)C3)c3ccccc23)c(O)c1 |
| InChI | InChI=1S/C20H23N5O/c1-13-10-17(26)19(21-11-13)18-15-7-3-4-8-16(15)20(24-23-18)22-14-6-5-9-25(2)12-14/h3-4,7-8,10-11,14,26H,5-6,9,12H2,1-2H3,(H,22,24)/t14-/m1/s1 |
| InChIKey | PCUPBMFHUSEREU-CQSZACIVSA-N |
| XLogP | 3.21 |
| TPSA | 74.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.44 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |