C16H24O7 — CID 166151626
5-O-[2-(3-hydroxy-3-methylbutoxy)ethyl] 2-O-propan-2-yl furan-2,5-dicarboxylate (PubChem CID 166151626) has the molecular formula C16H24O7 and a molecular weight of 328.36 g/mol. Its IUPAC name is 5-O-[2-(3-hydroxy-3-methylbutoxy)ethyl] 2-O-propan-2-yl furan-2,5-dicarboxylate.
| Compound Name | 5-O-[2-(3-hydroxy-3-methylbutoxy)ethyl] 2-O-propan-2-yl furan-2,5-dicarboxylate |
|---|---|
| PubChem CID | 166151626 |
| Molecular Formula | C16H24O7 |
| Molecular Weight | 328.36 g/mol |
| Exact Mass | 328.15 |
| IUPAC Name | 5-O-[2-(3-hydroxy-3-methylbutoxy)ethyl] 2-O-propan-2-yl furan-2,5-dicarboxylate |
| SMILES | CC(C)OC(=O)c1ccc(C(=O)OCCOCCC(C)(C)O)o1 |
| InChI | InChI=1S/C16H24O7/c1-11(2)22-15(18)13-6-5-12(23-13)14(17)21-10-9-20-8-7-16(3,4)19/h5-6,11,19H,7-10H2,1-4H3 |
| InChIKey | CBJKFVXKWGLUPZ-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 95.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.36 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|