C27H38NY- — CID 166151642
ethane;N,N,4-trimethyl-1-[(3E)-4-(2-methyl-4-prop-1-ynylbenzene-6-id-1-yl)hexa-1,3,5-trien-3-yl]cyclohexan-1-amine;yttrium (PubChem CID 166151642) has the molecular formula C27H38NY- and a molecular weight of 465.51 g/mol. Its IUPAC name is ethane;N,N,4-trimethyl-1-[(3E)-4-(2-methyl-4-prop-1-ynylbenzene-6-id-1-yl)hexa-1,3,5-trien-3-yl]cyclohexan-1-amine;yttrium.
| Compound Name | ethane;N,N,4-trimethyl-1-[(3E)-4-(2-methyl-4-prop-1-ynylbenzene-6-id-1-yl)hexa-1,3,5-trien-3-yl]cyclohexan-1-amine;yttrium |
|---|---|
| PubChem CID | 166151642 |
| Molecular Formula | C27H38NY- |
| Molecular Weight | 465.51 g/mol |
| Exact Mass | 465.21 |
| IUPAC Name | ethane;N,N,4-trimethyl-1-[(3E)-4-(2-methyl-4-prop-1-ynylbenzene-6-id-1-yl)hexa-1,3,5-trien-3-yl]cyclohexan-1-amine;yttrium |
| SMILES | C=C/C(=C(/C=C)C1(N(C)C)CCC(C)CC1)c1[c-]cc(C#CC)cc1C.CC.[Y] |
| InChI | InChI=1S/C25H32N.C2H6.Y/c1-8-11-21-12-13-23(20(5)18-21)22(9-2)24(10-3)25(26(6)7)16-14-19(4)15-17-25;1-2;/h9-10,12,18-19H,2-3,14-17H2,1,4-7H3;1-2H3;/q-1;;/b24-22+;; |
| InChIKey | SQHGHQMFDVNHFK-WPLNXYSRSA-N |
| XLogP | 6.83 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.51 |
| LogP ≤ 5 | 6.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|