About ethane;methanethiol;N-(2-methylsulfonylethyl)hexanamide
ethane;methanethiol;N-(2-methylsulfonylethyl)hexanamide (PubChem CID 166151964) has the molecular formula C12H29NO3S2
and a molecular weight of 299.50 g/mol. Its IUPAC name is ethane;methanethiol;N-(2-methylsulfonylethyl)hexanamide.
Molecular Properties
| Compound Name | ethane;methanethiol;N-(2-methylsulfonylethyl)hexanamide |
| PubChem CID | 166151964 |
| Molecular Formula | C12H29NO3S2 |
| Molecular Weight | 299.50 g/mol |
| Exact Mass | 299.16 |
| IUPAC Name | ethane;methanethiol;N-(2-methylsulfonylethyl)hexanamide |
| SMILES | CC.CCCCCC(=O)NCCS(C)(=O)=O.CS |
| InChI | InChI=1S/C9H19NO3S.C2H6.CH4S/c1-3-4-5-6-9(11)10-7-8-14(2,12)13;2*1-2/h3-8H2,1-2H3,(H,10,11);1-2H3;2H,1H3 |
| InChIKey | OPBPQEZGXMRJBN-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 63.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 299.50 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze ethane;methanethiol;N-(2-methylsulfonylethyl)hexanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;methanethiol;N-(2-methylsulfonylethyl)hexanamide?
The IUPAC name of ethane;methanethiol;N-(2-methylsulfonylethyl)hexanamide (CID 166151964) is ethane;methanethiol;N-(2-methylsulfonylethyl)hexanamide.
What is the SMILES notation for ethane;methanethiol;N-(2-methylsulfonylethyl)hexanamide?
The canonical SMILES for ethane;methanethiol;N-(2-methylsulfonylethyl)hexanamide is CC.CCCCCC(=O)NCCS(C)(=O)=O.CS.
What is the InChIKey of ethane;methanethiol;N-(2-methylsulfonylethyl)hexanamide?
The InChIKey is OPBPQEZGXMRJBN-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H19NO3S.C2H6.CH4S/c1-3-4-5-6-9(11)10-7-8-14(2,12)13;2*1-2/h3-8H2,1-2H3,(H,10,11);1-2H3;2H,1H3.
What are the key properties of ethane;methanethiol;N-(2-methylsulfonylethyl)hexanamide?
ethane;methanethiol;N-(2-methylsulfonylethyl)hexanamide has a molecular weight of 299.50 g/mol, XLogP of 2.30, 7 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;methanethiol;N-(2-methylsulfonylethyl)hexanamide is sourced from PubChem (CID 166151964), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).