C32H33ClFN3O3 — CID 166152066
tert-butyl 6-chloro-3-[3-(6-fluoronaphthalen-1-yl)oxypropyl]-7-(1,3,5-trimethylpyrazol-4-yl)-1H-indole-2-carboxylate (PubChem CID 166152066) has the molecular formula C32H33ClFN3O3 and a molecular weight of 562.09 g/mol. Its IUPAC name is tert-butyl 6-chloro-3-[3-(6-fluoronaphthalen-1-yl)oxypropyl]-7-(1,3,5-trimethylpyrazol-4-yl)-1H-indole-2-carboxylate.
| Compound Name | tert-butyl 6-chloro-3-[3-(6-fluoronaphthalen-1-yl)oxypropyl]-7-(1,3,5-trimethylpyrazol-4-yl)-1H-indole-2-carboxylate |
|---|---|
| PubChem CID | 166152066 |
| Molecular Formula | C32H33ClFN3O3 |
| Molecular Weight | 562.09 g/mol |
| Exact Mass | 561.22 |
| IUPAC Name | tert-butyl 6-chloro-3-[3-(6-fluoronaphthalen-1-yl)oxypropyl]-7-(1,3,5-trimethylpyrazol-4-yl)-1H-indole-2-carboxylate |
| SMILES | Cc1nn(C)c(C)c1-c1c(Cl)ccc2c(CCCOc3cccc4cc(F)ccc34)c(C(=O)OC(C)(C)C)[nH]c12 |
| InChI | InChI=1S/C32H33ClFN3O3/c1-18-27(19(2)37(6)36-18)28-25(33)15-14-24-23(30(35-29(24)28)31(38)40-32(3,4)5)10-8-16-39-26-11-7-9-20-17-21(34)12-13-22(20)26/h7,9,11-15,17,35H,8,10,16H2,1-6H3 |
| InChIKey | BQVFWAFFTJIULD-UHFFFAOYSA-N |
| XLogP | 8.10 |
| TPSA | 69.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 562.09 |
| LogP ≤ 5 | 8.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|