About 5-cyclobutyl-N-[2,5-difluoro-4-(trifluoromethyl)phenyl]-1H-pyrrole-3-sulfonamide
5-cyclobutyl-N-[2,5-difluoro-4-(trifluoromethyl)phenyl]-1H-pyrrole-3-sulfonamide (PubChem CID 166153951) has the molecular formula C15H13F5N2O2S
and a molecular weight of 380.34 g/mol. Its IUPAC name is 5-cyclobutyl-N-[2,5-difluoro-4-(trifluoromethyl)phenyl]-1H-pyrrole-3-sulfonamide.
Molecular Properties
| Compound Name | 5-cyclobutyl-N-[2,5-difluoro-4-(trifluoromethyl)phenyl]-1H-pyrrole-3-sulfonamide |
| PubChem CID | 166153951 |
| Molecular Formula | C15H13F5N2O2S |
| Molecular Weight | 380.34 g/mol |
| Exact Mass | 380.06 |
| IUPAC Name | 5-cyclobutyl-N-[2,5-difluoro-4-(trifluoromethyl)phenyl]-1H-pyrrole-3-sulfonamide |
| SMILES | O=S(=O)(Nc1cc(F)c(C(F)(F)F)cc1F)c1c[nH]c(C2CCC2)c1 |
| InChI | InChI=1S/C15H13F5N2O2S/c16-11-6-14(12(17)5-10(11)15(18,19)20)22-25(23,24)9-4-13(21-7-9)8-2-1-3-8/h4-8,21-22H,1-3H2 |
| InChIKey | JSTYGTDEJCNQAI-UHFFFAOYSA-N |
| XLogP | 4.38 |
| TPSA | 61.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 380.34 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 5-cyclobutyl-N-[2,5-difluoro-4-(trifluoromethyl)phenyl]-1H-pyrrole-3-sulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-cyclobutyl-N-[2,5-difluoro-4-(trifluoromethyl)phenyl]-1H-pyrrole-3-sulfonamide?
The IUPAC name of 5-cyclobutyl-N-[2,5-difluoro-4-(trifluoromethyl)phenyl]-1H-pyrrole-3-sulfonamide (CID 166153951) is 5-cyclobutyl-N-[2,5-difluoro-4-(trifluoromethyl)phenyl]-1H-pyrrole-3-sulfonamide.
What is the SMILES notation for 5-cyclobutyl-N-[2,5-difluoro-4-(trifluoromethyl)phenyl]-1H-pyrrole-3-sulfonamide?
The canonical SMILES for 5-cyclobutyl-N-[2,5-difluoro-4-(trifluoromethyl)phenyl]-1H-pyrrole-3-sulfonamide is O=S(=O)(Nc1cc(F)c(C(F)(F)F)cc1F)c1c[nH]c(C2CCC2)c1.
What is the InChIKey of 5-cyclobutyl-N-[2,5-difluoro-4-(trifluoromethyl)phenyl]-1H-pyrrole-3-sulfonamide?
The InChIKey is JSTYGTDEJCNQAI-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H13F5N2O2S/c16-11-6-14(12(17)5-10(11)15(18,19)20)22-25(23,24)9-4-13(21-7-9)8-2-1-3-8/h4-8,21-22H,1-3H2.
What are the key properties of 5-cyclobutyl-N-[2,5-difluoro-4-(trifluoromethyl)phenyl]-1H-pyrrole-3-sulfonamide?
5-cyclobutyl-N-[2,5-difluoro-4-(trifluoromethyl)phenyl]-1H-pyrrole-3-sulfonamide has a molecular weight of 380.34 g/mol, XLogP of 4.38, 4 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5-cyclobutyl-N-[2,5-difluoro-4-(trifluoromethyl)phenyl]-1H-pyrrole-3-sulfonamide is sourced from PubChem (CID 166153951), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).