C21H29NS — CID 166154080
4-[2-(2,4-dimethylphenyl)sulfanylphenyl]-N-propylbutan-1-amine (PubChem CID 166154080) has the molecular formula C21H29NS and a molecular weight of 327.54 g/mol. Its IUPAC name is 4-[2-(2,4-dimethylphenyl)sulfanylphenyl]-N-propylbutan-1-amine.
| Compound Name | 4-[2-(2,4-dimethylphenyl)sulfanylphenyl]-N-propylbutan-1-amine |
|---|---|
| PubChem CID | 166154080 |
| Molecular Formula | C21H29NS |
| Molecular Weight | 327.54 g/mol |
| Exact Mass | 327.20 |
| IUPAC Name | 4-[2-(2,4-dimethylphenyl)sulfanylphenyl]-N-propylbutan-1-amine |
| SMILES | CCCNCCCCc1ccccc1Sc1ccc(C)cc1C |
| InChI | InChI=1S/C21H29NS/c1-4-14-22-15-8-7-10-19-9-5-6-11-21(19)23-20-13-12-17(2)16-18(20)3/h5-6,9,11-13,16,22H,4,7-8,10,14-15H2,1-3H3 |
| InChIKey | CJFCKIMVWQXFCB-UHFFFAOYSA-N |
| XLogP | 5.78 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.54 |
| LogP ≤ 5 | 5.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|