C24H33N3O2 — CID 166154621
ethyl 5-(1-adamantyl)-7-pentylpyrazolo[1,5-a]pyrimidine-2-carboxylate (PubChem CID 166154621) has the molecular formula C24H33N3O2 and a molecular weight of 395.55 g/mol. Its IUPAC name is ethyl 5-(1-adamantyl)-7-pentylpyrazolo[1,5-a]pyrimidine-2-carboxylate.
| Compound Name | ethyl 5-(1-adamantyl)-7-pentylpyrazolo[1,5-a]pyrimidine-2-carboxylate |
|---|---|
| PubChem CID | 166154621 |
| Molecular Formula | C24H33N3O2 |
| Molecular Weight | 395.55 g/mol |
| Exact Mass | 395.26 |
| IUPAC Name | ethyl 5-(1-adamantyl)-7-pentylpyrazolo[1,5-a]pyrimidine-2-carboxylate |
| SMILES | CCCCCc1cc(C23CC4CC(CC(C4)C2)C3)nc2cc(C(=O)OCC)nn12 |
| InChI | InChI=1S/C24H33N3O2/c1-3-5-6-7-19-11-21(24-13-16-8-17(14-24)10-18(9-16)15-24)25-22-12-20(26-27(19)22)23(28)29-4-2/h11-12,16-18H,3-10,13-15H2,1-2H3 |
| InChIKey | NFTISPYNAXEWBR-UHFFFAOYSA-N |
| XLogP | 5.11 |
| TPSA | 56.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.55 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|