C23H24ClN5O4 — CID 166154744
2-(3-chlorophenyl)-N-[2-(4-methylpiperazin-1-yl)ethyl]-5-(2-nitrophenyl)-1,3-oxazole-4-carboxamide (PubChem CID 166154744) has the molecular formula C23H24ClN5O4 and a molecular weight of 469.93 g/mol. Its IUPAC name is 2-(3-chlorophenyl)-N-[2-(4-methylpiperazin-1-yl)ethyl]-5-(2-nitrophenyl)-1,3-oxazole-4-carboxamide.
| Compound Name | 2-(3-chlorophenyl)-N-[2-(4-methylpiperazin-1-yl)ethyl]-5-(2-nitrophenyl)-1,3-oxazole-4-carboxamide |
|---|---|
| PubChem CID | 166154744 |
| Molecular Formula | C23H24ClN5O4 |
| Molecular Weight | 469.93 g/mol |
| Exact Mass | 469.15 |
| IUPAC Name | 2-(3-chlorophenyl)-N-[2-(4-methylpiperazin-1-yl)ethyl]-5-(2-nitrophenyl)-1,3-oxazole-4-carboxamide |
| SMILES | CN1CCN(CCNC(=O)c2nc(-c3cccc(Cl)c3)oc2-c2ccccc2[N+](=O)[O-])CC1 |
| InChI | InChI=1S/C23H24ClN5O4/c1-27-11-13-28(14-12-27)10-9-25-22(30)20-21(18-7-2-3-8-19(18)29(31)32)33-23(26-20)16-5-4-6-17(24)15-16/h2-8,15H,9-14H2,1H3,(H,25,30) |
| InChIKey | JQQBHBMJTARURI-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 104.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.93 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|