About ethyl 5-[4-(methanesulfonamido)phenyl]-2-[4-(trifluoromethyl)phenyl]-1,3-oxazole-4-carboxylate
ethyl 5-[4-(methanesulfonamido)phenyl]-2-[4-(trifluoromethyl)phenyl]-1,3-oxazole-4-carboxylate (PubChem CID 166154766) has the molecular formula C20H17F3N2O5S
and a molecular weight of 454.43 g/mol. Its IUPAC name is ethyl 5-[4-(methanesulfonamido)phenyl]-2-[4-(trifluoromethyl)phenyl]-1,3-oxazole-4-carboxylate.
Molecular Properties
| Compound Name | ethyl 5-[4-(methanesulfonamido)phenyl]-2-[4-(trifluoromethyl)phenyl]-1,3-oxazole-4-carboxylate |
| PubChem CID | 166154766 |
| Molecular Formula | C20H17F3N2O5S |
| Molecular Weight | 454.43 g/mol |
| Exact Mass | 454.08 |
| IUPAC Name | ethyl 5-[4-(methanesulfonamido)phenyl]-2-[4-(trifluoromethyl)phenyl]-1,3-oxazole-4-carboxylate |
| SMILES | CCOC(=O)c1nc(-c2ccc(C(F)(F)F)cc2)oc1-c1ccc(NS(C)(=O)=O)cc1 |
| InChI | InChI=1S/C20H17F3N2O5S/c1-3-29-19(26)16-17(12-6-10-15(11-7-12)25-31(2,27)28)30-18(24-16)13-4-8-14(9-5-13)20(21,22)23/h4-11,25H,3H2,1-2H3 |
| InChIKey | OVRWSGKPZUIILC-UHFFFAOYSA-N |
| XLogP | 4.58 |
| TPSA | 98.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 454.43 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze ethyl 5-[4-(methanesulfonamido)phenyl]-2-[4-(trifluoromethyl)phenyl]-1,3-oxazole-4-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 5-[4-(methanesulfonamido)phenyl]-2-[4-(trifluoromethyl)phenyl]-1,3-oxazole-4-carboxylate?
The IUPAC name of ethyl 5-[4-(methanesulfonamido)phenyl]-2-[4-(trifluoromethyl)phenyl]-1,3-oxazole-4-carboxylate (CID 166154766) is ethyl 5-[4-(methanesulfonamido)phenyl]-2-[4-(trifluoromethyl)phenyl]-1,3-oxazole-4-carboxylate.
What is the SMILES notation for ethyl 5-[4-(methanesulfonamido)phenyl]-2-[4-(trifluoromethyl)phenyl]-1,3-oxazole-4-carboxylate?
The canonical SMILES for ethyl 5-[4-(methanesulfonamido)phenyl]-2-[4-(trifluoromethyl)phenyl]-1,3-oxazole-4-carboxylate is CCOC(=O)c1nc(-c2ccc(C(F)(F)F)cc2)oc1-c1ccc(NS(C)(=O)=O)cc1.
What is the InChIKey of ethyl 5-[4-(methanesulfonamido)phenyl]-2-[4-(trifluoromethyl)phenyl]-1,3-oxazole-4-carboxylate?
The InChIKey is OVRWSGKPZUIILC-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H17F3N2O5S/c1-3-29-19(26)16-17(12-6-10-15(11-7-12)25-31(2,27)28)30-18(24-16)13-4-8-14(9-5-13)20(21,22)23/h4-11,25H,3H2,1-2H3.
What are the key properties of ethyl 5-[4-(methanesulfonamido)phenyl]-2-[4-(trifluoromethyl)phenyl]-1,3-oxazole-4-carboxylate?
ethyl 5-[4-(methanesulfonamido)phenyl]-2-[4-(trifluoromethyl)phenyl]-1,3-oxazole-4-carboxylate has a molecular weight of 454.43 g/mol, XLogP of 4.58, 6 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 5-[4-(methanesulfonamido)phenyl]-2-[4-(trifluoromethyl)phenyl]-1,3-oxazole-4-carboxylate is sourced from PubChem (CID 166154766), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).