C23H23F2N5O4 — CID 166154814
2-(3,5-difluorophenyl)-N-[2-(4-methylpiperazin-1-yl)ethyl]-5-(2-nitrophenyl)-1,3-oxazole-4-carboxamide (PubChem CID 166154814) has the molecular formula C23H23F2N5O4 and a molecular weight of 471.46 g/mol. Its IUPAC name is 2-(3,5-difluorophenyl)-N-[2-(4-methylpiperazin-1-yl)ethyl]-5-(2-nitrophenyl)-1,3-oxazole-4-carboxamide.
| Compound Name | 2-(3,5-difluorophenyl)-N-[2-(4-methylpiperazin-1-yl)ethyl]-5-(2-nitrophenyl)-1,3-oxazole-4-carboxamide |
|---|---|
| PubChem CID | 166154814 |
| Molecular Formula | C23H23F2N5O4 |
| Molecular Weight | 471.46 g/mol |
| Exact Mass | 471.17 |
| IUPAC Name | 2-(3,5-difluorophenyl)-N-[2-(4-methylpiperazin-1-yl)ethyl]-5-(2-nitrophenyl)-1,3-oxazole-4-carboxamide |
| SMILES | CN1CCN(CCNC(=O)c2nc(-c3cc(F)cc(F)c3)oc2-c2ccccc2[N+](=O)[O-])CC1 |
| InChI | InChI=1S/C23H23F2N5O4/c1-28-8-10-29(11-9-28)7-6-26-22(31)20-21(18-4-2-3-5-19(18)30(32)33)34-23(27-20)15-12-16(24)14-17(25)13-15/h2-5,12-14H,6-11H2,1H3,(H,26,31) |
| InChIKey | YXJCTNIHAAVFFC-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 104.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.46 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|