About (4-acetylphenyl) 3-(2-oxo-3,4-dihydro-1H-quinolin-3-yl)propanoate
(4-acetylphenyl) 3-(2-oxo-3,4-dihydro-1H-quinolin-3-yl)propanoate (PubChem CID 16615487) has the molecular formula C20H19NO4
and a molecular weight of 337.38 g/mol. Its IUPAC name is (4-acetylphenyl) 3-(2-oxo-3,4-dihydro-1H-quinolin-3-yl)propanoate.
Molecular Properties
| Compound Name | (4-acetylphenyl) 3-(2-oxo-3,4-dihydro-1H-quinolin-3-yl)propanoate |
| PubChem CID | 16615487 |
| Molecular Formula | C20H19NO4 |
| Molecular Weight | 337.38 g/mol |
| Exact Mass | 337.13 |
| IUPAC Name | (4-acetylphenyl) 3-(2-oxo-3,4-dihydro-1H-quinolin-3-yl)propanoate |
| SMILES | CC(=O)c1ccc(OC(=O)CCC2Cc3ccccc3NC2=O)cc1 |
| InChI | InChI=1S/C20H19NO4/c1-13(22)14-6-9-17(10-7-14)25-19(23)11-8-16-12-15-4-2-3-5-18(15)21-20(16)24/h2-7,9-10,16H,8,11-12H2,1H3,(H,21,24) |
| InChIKey | MRAJMOXVZYAWML-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 337.38 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|
Analyze (4-acetylphenyl) 3-(2-oxo-3,4-dihydro-1H-quinolin-3-yl)propanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4-acetylphenyl) 3-(2-oxo-3,4-dihydro-1H-quinolin-3-yl)propanoate?
The IUPAC name of (4-acetylphenyl) 3-(2-oxo-3,4-dihydro-1H-quinolin-3-yl)propanoate (CID 16615487) is (4-acetylphenyl) 3-(2-oxo-3,4-dihydro-1H-quinolin-3-yl)propanoate.
What is the SMILES notation for (4-acetylphenyl) 3-(2-oxo-3,4-dihydro-1H-quinolin-3-yl)propanoate?
The canonical SMILES for (4-acetylphenyl) 3-(2-oxo-3,4-dihydro-1H-quinolin-3-yl)propanoate is CC(=O)c1ccc(OC(=O)CCC2Cc3ccccc3NC2=O)cc1.
What is the InChIKey of (4-acetylphenyl) 3-(2-oxo-3,4-dihydro-1H-quinolin-3-yl)propanoate?
The InChIKey is MRAJMOXVZYAWML-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H19NO4/c1-13(22)14-6-9-17(10-7-14)25-19(23)11-8-16-12-15-4-2-3-5-18(15)21-20(16)24/h2-7,9-10,16H,8,11-12H2,1H3,(H,21,24).
What are the key properties of (4-acetylphenyl) 3-(2-oxo-3,4-dihydro-1H-quinolin-3-yl)propanoate?
(4-acetylphenyl) 3-(2-oxo-3,4-dihydro-1H-quinolin-3-yl)propanoate has a molecular weight of 337.38 g/mol, XLogP of 3.39, 5 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (4-acetylphenyl) 3-(2-oxo-3,4-dihydro-1H-quinolin-3-yl)propanoate is sourced from PubChem (CID 16615487), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).