C34H48Cl2N4O5 — CID 166155352
tert-butyl N-[3-[4-[2-[6-chloro-3-[3-(4-chloro-3,5-dimethylphenoxy)propyl]-2-(dihydroxymethyl)indol-1-yl]ethyl]piperazin-1-yl]propyl]carbamate (PubChem CID 166155352) has the molecular formula C34H48Cl2N4O5 and a molecular weight of 663.69 g/mol. Its IUPAC name is tert-butyl N-[3-[4-[2-[6-chloro-3-[3-(4-chloro-3,5-dimethylphenoxy)propyl]-2-(dihydroxymethyl)indol-1-yl]ethyl]piperazin-1-yl]propyl]carbamate.
| Compound Name | tert-butyl N-[3-[4-[2-[6-chloro-3-[3-(4-chloro-3,5-dimethylphenoxy)propyl]-2-(dihydroxymethyl)indol-1-yl]ethyl]piperazin-1-yl]propyl]carbamate |
|---|---|
| PubChem CID | 166155352 |
| Molecular Formula | C34H48Cl2N4O5 |
| Molecular Weight | 663.69 g/mol |
| Exact Mass | 662.30 |
| IUPAC Name | tert-butyl N-[3-[4-[2-[6-chloro-3-[3-(4-chloro-3,5-dimethylphenoxy)propyl]-2-(dihydroxymethyl)indol-1-yl]ethyl]piperazin-1-yl]propyl]carbamate |
| SMILES | Cc1cc(OCCCc2c(C(O)O)n(CCN3CCN(CCCNC(=O)OC(C)(C)C)CC3)c3cc(Cl)ccc23)cc(C)c1Cl |
| InChI | InChI=1S/C34H48Cl2N4O5/c1-23-20-26(21-24(2)30(23)36)44-19-6-8-28-27-10-9-25(35)22-29(27)40(31(28)32(41)42)18-17-39-15-13-38(14-16-39)12-7-11-37-33(43)45-34(3,4)5/h9-10,20-22,32,41-42H,6-8,11-19H2,1-5H3,(H,37,43) |
| InChIKey | HTJXXWHXWMOVMS-UHFFFAOYSA-N |
| XLogP | 6.09 |
| TPSA | 99.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 663.69 |
| LogP ≤ 5 | 6.09 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|