C17H25F3N4O3 — CID 166156670
(1R,2S,5S)-N-[(1S)-1-aminoethyl]-3-[(2S)-2-cyclopropyl-2-[(2,2,2-trifluoroacetyl)amino]acetyl]-6,6-dimethyl-3-azabicyclo[3.1.0]hexane-2-carboxamide (PubChem CID 166156670) has the molecular formula C17H25F3N4O3 and a molecular weight of 390.41 g/mol. Its IUPAC name is (1R,2S,5S)-N-[(1S)-1-aminoethyl]-3-[(2S)-2-cyclopropyl-2-[(2,2,2-trifluoroacetyl)amino]acetyl]-6,6-dimethyl-3-azabicyclo[3.1.0]hexane-2-carboxamide.
| Compound Name | (1R,2S,5S)-N-[(1S)-1-aminoethyl]-3-[(2S)-2-cyclopropyl-2-[(2,2,2-trifluoroacetyl)amino]acetyl]-6,6-dimethyl-3-azabicyclo[3.1.0]hexane-2-carboxamide |
|---|---|
| PubChem CID | 166156670 |
| Molecular Formula | C17H25F3N4O3 |
| Molecular Weight | 390.41 g/mol |
| Exact Mass | 390.19 |
| IUPAC Name | (1R,2S,5S)-N-[(1S)-1-aminoethyl]-3-[(2S)-2-cyclopropyl-2-[(2,2,2-trifluoroacetyl)amino]acetyl]-6,6-dimethyl-3-azabicyclo[3.1.0]hexane-2-carboxamide |
| SMILES | C[C@@H](N)NC(=O)[C@@H]1[C@@H]2[C@H](CN1C(=O)[C@@H](NC(=O)C(F)(F)F)C1CC1)C2(C)C |
| InChI | InChI=1S/C17H25F3N4O3/c1-7(21)22-13(25)12-10-9(16(10,2)3)6-24(12)14(26)11(8-4-5-8)23-15(27)17(18,19)20/h7-12H,4-6,21H2,1-3H3,(H,22,25)(H,23,27)/t7-,9-,10-,11-,12-/m0/s1 |
| InChIKey | LBBYCUGRBBQSBC-NLTWPBFGSA-N |
| XLogP | 0.35 |
| TPSA | 104.53 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.41 |
| LogP ≤ 5 | 0.35 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|