About 6,6-dimethyl-3-azabicyclo[3.1.0]hexane;methane;methyl formate
6,6-dimethyl-3-azabicyclo[3.1.0]hexane;methane;methyl formate (PubChem CID 166156697) has the molecular formula C10H21NO2
and a molecular weight of 187.28 g/mol. Its IUPAC name is 6,6-dimethyl-3-azabicyclo[3.1.0]hexane;methane;methyl formate.
Molecular Properties
| Compound Name | 6,6-dimethyl-3-azabicyclo[3.1.0]hexane;methane;methyl formate |
| PubChem CID | 166156697 |
| Molecular Formula | C10H21NO2 |
| Molecular Weight | 187.28 g/mol |
| Exact Mass | 187.16 |
| IUPAC Name | 6,6-dimethyl-3-azabicyclo[3.1.0]hexane;methane;methyl formate |
| SMILES | C.CC1(C)C2CNCC21.COC=O |
| InChI | InChI=1S/C7H13N.C2H4O2.CH4/c1-7(2)5-3-8-4-6(5)7;1-4-2-3;/h5-6,8H,3-4H2,1-2H3;2H,1H3;1H4 |
| InChIKey | WDEPPRAMICYNIK-UHFFFAOYSA-N |
| XLogP | 1.29 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 187.28 |
| LogP ≤ 5 | 1.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze 6,6-dimethyl-3-azabicyclo[3.1.0]hexane;methane;methyl formate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6,6-dimethyl-3-azabicyclo[3.1.0]hexane;methane;methyl formate?
The IUPAC name of 6,6-dimethyl-3-azabicyclo[3.1.0]hexane;methane;methyl formate (CID 166156697) is 6,6-dimethyl-3-azabicyclo[3.1.0]hexane;methane;methyl formate.
What is the SMILES notation for 6,6-dimethyl-3-azabicyclo[3.1.0]hexane;methane;methyl formate?
The canonical SMILES for 6,6-dimethyl-3-azabicyclo[3.1.0]hexane;methane;methyl formate is C.CC1(C)C2CNCC21.COC=O.
What is the InChIKey of 6,6-dimethyl-3-azabicyclo[3.1.0]hexane;methane;methyl formate?
The InChIKey is WDEPPRAMICYNIK-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H13N.C2H4O2.CH4/c1-7(2)5-3-8-4-6(5)7;1-4-2-3;/h5-6,8H,3-4H2,1-2H3;2H,1H3;1H4.
What are the key properties of 6,6-dimethyl-3-azabicyclo[3.1.0]hexane;methane;methyl formate?
6,6-dimethyl-3-azabicyclo[3.1.0]hexane;methane;methyl formate has a molecular weight of 187.28 g/mol, XLogP of 1.29, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 6,6-dimethyl-3-azabicyclo[3.1.0]hexane;methane;methyl formate is sourced from PubChem (CID 166156697), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).