C20H31F3N4O3 — CID 166156828
(2S,5S)-N-(1-cyanoethyl)-5,6,6-trimethyl-3-[2-[(2,2,2-trifluoroacetyl)amino]acetyl]-3-azabicyclo[3.1.0]hexane-2-carboxamide;2-methylpropane (PubChem CID 166156828) has the molecular formula C20H31F3N4O3 and a molecular weight of 432.49 g/mol. Its IUPAC name is (2S,5S)-N-(1-cyanoethyl)-5,6,6-trimethyl-3-[2-[(2,2,2-trifluoroacetyl)amino]acetyl]-3-azabicyclo[3.1.0]hexane-2-carboxamide;2-methylpropane.
| Compound Name | (2S,5S)-N-(1-cyanoethyl)-5,6,6-trimethyl-3-[2-[(2,2,2-trifluoroacetyl)amino]acetyl]-3-azabicyclo[3.1.0]hexane-2-carboxamide;2-methylpropane |
|---|---|
| PubChem CID | 166156828 |
| Molecular Formula | C20H31F3N4O3 |
| Molecular Weight | 432.49 g/mol |
| Exact Mass | 432.23 |
| IUPAC Name | (2S,5S)-N-(1-cyanoethyl)-5,6,6-trimethyl-3-[2-[(2,2,2-trifluoroacetyl)amino]acetyl]-3-azabicyclo[3.1.0]hexane-2-carboxamide;2-methylpropane |
| SMILES | CC(C#N)NC(=O)[C@@H]1C2C(C)(C)[C@@]2(C)CN1C(=O)CNC(=O)C(F)(F)F.CC(C)C |
| InChI | InChI=1S/C16H21F3N4O3.C4H10/c1-8(5-20)22-12(25)10-11-14(2,3)15(11,4)7-23(10)9(24)6-21-13(26)16(17,18)19;1-4(2)3/h8,10-11H,6-7H2,1-4H3,(H,21,26)(H,22,25);4H,1-3H3/t8?,10-,11?,15-;/m0./s1 |
| InChIKey | UOIBXDSMATZFKZ-CAKPZLOVSA-N |
| XLogP | 2.23 |
| TPSA | 102.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.49 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |