C19H29F3N4O3 — CID 166156873
(1R,2S,5S)-N-[(1S)-1-amino-2-methylpropyl]-3-[(2S)-2-cyclopropyl-2-[(2,2,2-trifluoroacetyl)amino]acetyl]-6,6-dimethyl-3-azabicyclo[3.1.0]hexane-2-carboxamide (PubChem CID 166156873) has the molecular formula C19H29F3N4O3 and a molecular weight of 418.46 g/mol. Its IUPAC name is (1R,2S,5S)-N-[(1S)-1-amino-2-methylpropyl]-3-[(2S)-2-cyclopropyl-2-[(2,2,2-trifluoroacetyl)amino]acetyl]-6,6-dimethyl-3-azabicyclo[3.1.0]hexane-2-carboxamide.
| Compound Name | (1R,2S,5S)-N-[(1S)-1-amino-2-methylpropyl]-3-[(2S)-2-cyclopropyl-2-[(2,2,2-trifluoroacetyl)amino]acetyl]-6,6-dimethyl-3-azabicyclo[3.1.0]hexane-2-carboxamide |
|---|---|
| PubChem CID | 166156873 |
| Molecular Formula | C19H29F3N4O3 |
| Molecular Weight | 418.46 g/mol |
| Exact Mass | 418.22 |
| IUPAC Name | (1R,2S,5S)-N-[(1S)-1-amino-2-methylpropyl]-3-[(2S)-2-cyclopropyl-2-[(2,2,2-trifluoroacetyl)amino]acetyl]-6,6-dimethyl-3-azabicyclo[3.1.0]hexane-2-carboxamide |
| SMILES | CC(C)[C@@H](N)NC(=O)[C@@H]1[C@@H]2[C@H](CN1C(=O)[C@@H](NC(=O)C(F)(F)F)C1CC1)C2(C)C |
| InChI | InChI=1S/C19H29F3N4O3/c1-8(2)14(23)25-15(27)13-11-10(18(11,3)4)7-26(13)16(28)12(9-5-6-9)24-17(29)19(20,21)22/h8-14H,5-7,23H2,1-4H3,(H,24,29)(H,25,27)/t10-,11-,12-,13-,14-/m0/s1 |
| InChIKey | GPAGFFIIANMXKF-PEDHHIEDSA-N |
| XLogP | 0.98 |
| TPSA | 104.53 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.46 |
| LogP ≤ 5 | 0.98 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|