C19H28F3N3O5 — CID 166156886
(2S)-2-[[(1R,2S,5S)-3-[(2S)-3,3-dimethyl-2-[(2,2,2-trifluoroacetyl)amino]butanoyl]-6,6-dimethyl-3-azabicyclo[3.1.0]hexane-2-carbonyl]amino]propanoic acid (PubChem CID 166156886) has the molecular formula C19H28F3N3O5 and a molecular weight of 435.44 g/mol. Its IUPAC name is (2S)-2-[[(1R,2S,5S)-3-[(2S)-3,3-dimethyl-2-[(2,2,2-trifluoroacetyl)amino]butanoyl]-6,6-dimethyl-3-azabicyclo[3.1.0]hexane-2-carbonyl]amino]propanoic acid.
| Compound Name | (2S)-2-[[(1R,2S,5S)-3-[(2S)-3,3-dimethyl-2-[(2,2,2-trifluoroacetyl)amino]butanoyl]-6,6-dimethyl-3-azabicyclo[3.1.0]hexane-2-carbonyl]amino]propanoic acid |
|---|---|
| PubChem CID | 166156886 |
| Molecular Formula | C19H28F3N3O5 |
| Molecular Weight | 435.44 g/mol |
| Exact Mass | 435.20 |
| IUPAC Name | (2S)-2-[[(1R,2S,5S)-3-[(2S)-3,3-dimethyl-2-[(2,2,2-trifluoroacetyl)amino]butanoyl]-6,6-dimethyl-3-azabicyclo[3.1.0]hexane-2-carbonyl]amino]propanoic acid |
| SMILES | C[C@H](NC(=O)[C@@H]1[C@@H]2[C@H](CN1C(=O)[C@@H](NC(=O)C(F)(F)F)C(C)(C)C)C2(C)C)C(=O)O |
| InChI | InChI=1S/C19H28F3N3O5/c1-8(15(28)29)23-13(26)11-10-9(18(10,5)6)7-25(11)14(27)12(17(2,3)4)24-16(30)19(20,21)22/h8-12H,7H2,1-6H3,(H,23,26)(H,24,30)(H,28,29)/t8-,9-,10-,11-,12+/m0/s1 |
| InChIKey | GCWCCRGYPZKONV-UHFZAUJKSA-N |
| XLogP | 1.15 |
| TPSA | 115.81 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.44 |
| LogP ≤ 5 | 1.15 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |