C20H27F2N5O5 — CID 166156957
(1R,2S,5S)-N-[(1R)-1-cyano-2-[(3S)-2-oxopiperidin-3-yl]ethyl]-3-[(2S)-2-[(2,2-difluoroacetyl)amino]-2-hydroxyacetyl]-6,6-dimethyl-3-azabicyclo[3.1.0]hexane-2-carboxamide (PubChem CID 166156957) has the molecular formula C20H27F2N5O5 and a molecular weight of 455.46 g/mol. Its IUPAC name is (1R,2S,5S)-N-[(1R)-1-cyano-2-[(3S)-2-oxopiperidin-3-yl]ethyl]-3-[(2S)-2-[(2,2-difluoroacetyl)amino]-2-hydroxyacetyl]-6,6-dimethyl-3-azabicyclo[3.1.0]hexane-2-carboxamide.
| Compound Name | (1R,2S,5S)-N-[(1R)-1-cyano-2-[(3S)-2-oxopiperidin-3-yl]ethyl]-3-[(2S)-2-[(2,2-difluoroacetyl)amino]-2-hydroxyacetyl]-6,6-dimethyl-3-azabicyclo[3.1.0]hexane-2-carboxamide |
|---|---|
| PubChem CID | 166156957 |
| Molecular Formula | C20H27F2N5O5 |
| Molecular Weight | 455.46 g/mol |
| Exact Mass | 455.20 |
| IUPAC Name | (1R,2S,5S)-N-[(1R)-1-cyano-2-[(3S)-2-oxopiperidin-3-yl]ethyl]-3-[(2S)-2-[(2,2-difluoroacetyl)amino]-2-hydroxyacetyl]-6,6-dimethyl-3-azabicyclo[3.1.0]hexane-2-carboxamide |
| SMILES | CC1(C)[C@@H]2[C@@H](C(=O)N[C@@H](C#N)C[C@@H]3CCCNC3=O)N(C(=O)[C@H](O)NC(=O)C(F)F)C[C@@H]21 |
| InChI | InChI=1S/C20H27F2N5O5/c1-20(2)11-8-27(19(32)18(31)26-17(30)14(21)22)13(12(11)20)16(29)25-10(7-23)6-9-4-3-5-24-15(9)28/h9-14,18,31H,3-6,8H2,1-2H3,(H,24,28)(H,25,29)(H,26,30)/t9-,10+,11-,12-,13-,18-/m0/s1 |
| InChIKey | DOIYWFBHZNUWEY-QUNJAEBKSA-N |
| XLogP | -0.91 |
| TPSA | 151.63 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.46 |
| LogP ≤ 5 | -0.91 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|