C18H29F3N4O3 — CID 166157132
(1R,2S,5S)-N-[(1S)-1-aminoethyl]-3-[(2S)-3,3-dimethyl-2-[(2,2,2-trifluoroacetyl)amino]butanoyl]-6,6-dimethyl-3-azabicyclo[3.1.0]hexane-2-carboxamide (PubChem CID 166157132) has the molecular formula C18H29F3N4O3 and a molecular weight of 406.45 g/mol. Its IUPAC name is (1R,2S,5S)-N-[(1S)-1-aminoethyl]-3-[(2S)-3,3-dimethyl-2-[(2,2,2-trifluoroacetyl)amino]butanoyl]-6,6-dimethyl-3-azabicyclo[3.1.0]hexane-2-carboxamide.
| Compound Name | (1R,2S,5S)-N-[(1S)-1-aminoethyl]-3-[(2S)-3,3-dimethyl-2-[(2,2,2-trifluoroacetyl)amino]butanoyl]-6,6-dimethyl-3-azabicyclo[3.1.0]hexane-2-carboxamide |
|---|---|
| PubChem CID | 166157132 |
| Molecular Formula | C18H29F3N4O3 |
| Molecular Weight | 406.45 g/mol |
| Exact Mass | 406.22 |
| IUPAC Name | (1R,2S,5S)-N-[(1S)-1-aminoethyl]-3-[(2S)-3,3-dimethyl-2-[(2,2,2-trifluoroacetyl)amino]butanoyl]-6,6-dimethyl-3-azabicyclo[3.1.0]hexane-2-carboxamide |
| SMILES | C[C@@H](N)NC(=O)[C@@H]1[C@@H]2[C@H](CN1C(=O)[C@@H](NC(=O)C(F)(F)F)C(C)(C)C)C2(C)C |
| InChI | InChI=1S/C18H29F3N4O3/c1-8(22)23-13(26)11-10-9(17(10,5)6)7-25(11)14(27)12(16(2,3)4)24-15(28)18(19,20)21/h8-12H,7,22H2,1-6H3,(H,23,26)(H,24,28)/t8-,9-,10-,11-,12+/m0/s1 |
| InChIKey | QVNVRQRDBTXLEL-UHFZAUJKSA-N |
| XLogP | 0.98 |
| TPSA | 104.53 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.45 |
| LogP ≤ 5 | 0.98 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|