C26H39F3N4O5 — CID 166157220
(2S,4S)-1-[(2S)-3,3-dimethyl-2-[(2,2,2-trifluoroacetyl)amino]butanoyl]-3,3,4-trimethyl-N-[(2S)-3-oxo-1-[(3S)-2-oxopiperidin-3-yl]pent-4-en-2-yl]pyrrolidine-2-carboxamide (PubChem CID 166157220) has the molecular formula C26H39F3N4O5 and a molecular weight of 544.62 g/mol. Its IUPAC name is (2S,4S)-1-[(2S)-3,3-dimethyl-2-[(2,2,2-trifluoroacetyl)amino]butanoyl]-3,3,4-trimethyl-N-[(2S)-3-oxo-1-[(3S)-2-oxopiperidin-3-yl]pent-4-en-2-yl]pyrrolidine-2-carboxamide.
| Compound Name | (2S,4S)-1-[(2S)-3,3-dimethyl-2-[(2,2,2-trifluoroacetyl)amino]butanoyl]-3,3,4-trimethyl-N-[(2S)-3-oxo-1-[(3S)-2-oxopiperidin-3-yl]pent-4-en-2-yl]pyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 166157220 |
| Molecular Formula | C26H39F3N4O5 |
| Molecular Weight | 544.62 g/mol |
| Exact Mass | 544.29 |
| IUPAC Name | (2S,4S)-1-[(2S)-3,3-dimethyl-2-[(2,2,2-trifluoroacetyl)amino]butanoyl]-3,3,4-trimethyl-N-[(2S)-3-oxo-1-[(3S)-2-oxopiperidin-3-yl]pent-4-en-2-yl]pyrrolidine-2-carboxamide |
| SMILES | C=CC(=O)[C@H](C[C@@H]1CCCNC1=O)NC(=O)[C@H]1N(C(=O)[C@@H](NC(=O)C(F)(F)F)C(C)(C)C)C[C@@H](C)C1(C)C |
| InChI | InChI=1S/C26H39F3N4O5/c1-8-17(34)16(12-15-10-9-11-30-20(15)35)31-21(36)19-25(6,7)14(2)13-33(19)22(37)18(24(3,4)5)32-23(38)26(27,28)29/h8,14-16,18-19H,1,9-13H2,2-7H3,(H,30,35)(H,31,36)(H,32,38)/t14-,15+,16+,18-,19-/m1/s1 |
| InChIKey | BKYNNRXJTKIPTC-WHEVEAIOSA-N |
| XLogP | 2.11 |
| TPSA | 124.68 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 544.62 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|