C20H33F3N4O3 — CID 166157228
(1R,2S,5S)-N-[(1S)-1-amino-2-methylpropyl]-3-[(2S)-3,3-dimethyl-2-[(2,2,2-trifluoroacetyl)amino]butanoyl]-6,6-dimethyl-3-azabicyclo[3.1.0]hexane-2-carboxamide (PubChem CID 166157228) has the molecular formula C20H33F3N4O3 and a molecular weight of 434.50 g/mol. Its IUPAC name is (1R,2S,5S)-N-[(1S)-1-amino-2-methylpropyl]-3-[(2S)-3,3-dimethyl-2-[(2,2,2-trifluoroacetyl)amino]butanoyl]-6,6-dimethyl-3-azabicyclo[3.1.0]hexane-2-carboxamide.
| Compound Name | (1R,2S,5S)-N-[(1S)-1-amino-2-methylpropyl]-3-[(2S)-3,3-dimethyl-2-[(2,2,2-trifluoroacetyl)amino]butanoyl]-6,6-dimethyl-3-azabicyclo[3.1.0]hexane-2-carboxamide |
|---|---|
| PubChem CID | 166157228 |
| Molecular Formula | C20H33F3N4O3 |
| Molecular Weight | 434.50 g/mol |
| Exact Mass | 434.25 |
| IUPAC Name | (1R,2S,5S)-N-[(1S)-1-amino-2-methylpropyl]-3-[(2S)-3,3-dimethyl-2-[(2,2,2-trifluoroacetyl)amino]butanoyl]-6,6-dimethyl-3-azabicyclo[3.1.0]hexane-2-carboxamide |
| SMILES | CC(C)[C@@H](N)NC(=O)[C@@H]1[C@@H]2[C@H](CN1C(=O)[C@@H](NC(=O)C(F)(F)F)C(C)(C)C)C2(C)C |
| InChI | InChI=1S/C20H33F3N4O3/c1-9(2)14(24)26-15(28)12-11-10(19(11,6)7)8-27(12)16(29)13(18(3,4)5)25-17(30)20(21,22)23/h9-14H,8,24H2,1-7H3,(H,25,30)(H,26,28)/t10-,11-,12-,13+,14-/m0/s1 |
| InChIKey | OKWUYIJMPUVVPZ-YHQUGGNUSA-N |
| XLogP | 1.62 |
| TPSA | 104.53 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.50 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|