C20H30F3N3O5 — CID 166157277
methyl (2S)-2-[[(1R,2S,5S)-3-[(2S)-3,3-dimethyl-2-[(2,2,2-trifluoroacetyl)amino]butanoyl]-6,6-dimethyl-3-azabicyclo[3.1.0]hexane-2-carbonyl]amino]propanoate (PubChem CID 166157277) has the molecular formula C20H30F3N3O5 and a molecular weight of 449.47 g/mol. Its IUPAC name is methyl (2S)-2-[[(1R,2S,5S)-3-[(2S)-3,3-dimethyl-2-[(2,2,2-trifluoroacetyl)amino]butanoyl]-6,6-dimethyl-3-azabicyclo[3.1.0]hexane-2-carbonyl]amino]propanoate.
| Compound Name | methyl (2S)-2-[[(1R,2S,5S)-3-[(2S)-3,3-dimethyl-2-[(2,2,2-trifluoroacetyl)amino]butanoyl]-6,6-dimethyl-3-azabicyclo[3.1.0]hexane-2-carbonyl]amino]propanoate |
|---|---|
| PubChem CID | 166157277 |
| Molecular Formula | C20H30F3N3O5 |
| Molecular Weight | 449.47 g/mol |
| Exact Mass | 449.21 |
| IUPAC Name | methyl (2S)-2-[[(1R,2S,5S)-3-[(2S)-3,3-dimethyl-2-[(2,2,2-trifluoroacetyl)amino]butanoyl]-6,6-dimethyl-3-azabicyclo[3.1.0]hexane-2-carbonyl]amino]propanoate |
| SMILES | COC(=O)[C@H](C)NC(=O)[C@@H]1[C@@H]2[C@H](CN1C(=O)[C@@H](NC(=O)C(F)(F)F)C(C)(C)C)C2(C)C |
| InChI | InChI=1S/C20H30F3N3O5/c1-9(16(29)31-7)24-14(27)12-11-10(19(11,5)6)8-26(12)15(28)13(18(2,3)4)25-17(30)20(21,22)23/h9-13H,8H2,1-7H3,(H,24,27)(H,25,30)/t9-,10-,11-,12-,13+/m0/s1 |
| InChIKey | YPWYGDTWVXSFJV-PJSNJIKXSA-N |
| XLogP | 1.24 |
| TPSA | 104.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.47 |
| LogP ≤ 5 | 1.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |