C9H16FN — CID 166157427
4-fluoro-1-propan-2-yl-2,3,6,7-tetrahydroazepine (PubChem CID 166157427) has the molecular formula C9H16FN and a molecular weight of 157.23 g/mol. Its IUPAC name is 4-fluoro-1-propan-2-yl-2,3,6,7-tetrahydroazepine.
| Compound Name | 4-fluoro-1-propan-2-yl-2,3,6,7-tetrahydroazepine |
|---|---|
| PubChem CID | 166157427 |
| Molecular Formula | C9H16FN |
| Molecular Weight | 157.23 g/mol |
| Exact Mass | 157.13 |
| IUPAC Name | 4-fluoro-1-propan-2-yl-2,3,6,7-tetrahydroazepine |
| SMILES | CC(C)N1CCC=C(F)CC1 |
| InChI | InChI=1S/C9H16FN/c1-8(2)11-6-3-4-9(10)5-7-11/h4,8H,3,5-7H2,1-2H3 |
| InChIKey | FKMCLFKKEQEDJS-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 157.23 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |