About 5-fluoro-1-methyl-3,6-dihydro-2H-pyridine;1-propan-2-ylazepane-4-carbonitrile
5-fluoro-1-methyl-3,6-dihydro-2H-pyridine;1-propan-2-ylazepane-4-carbonitrile (PubChem CID 166157611) has the molecular formula C16H28FN3
and a molecular weight of 281.42 g/mol. Its IUPAC name is 5-fluoro-1-methyl-3,6-dihydro-2H-pyridine;1-propan-2-ylazepane-4-carbonitrile.
Molecular Properties
| Compound Name | 5-fluoro-1-methyl-3,6-dihydro-2H-pyridine;1-propan-2-ylazepane-4-carbonitrile |
| PubChem CID | 166157611 |
| Molecular Formula | C16H28FN3 |
| Molecular Weight | 281.42 g/mol |
| Exact Mass | 281.23 |
| IUPAC Name | 5-fluoro-1-methyl-3,6-dihydro-2H-pyridine;1-propan-2-ylazepane-4-carbonitrile |
| SMILES | CC(C)N1CCCC(C#N)CC1.CN1CCC=C(F)C1 |
| InChI | InChI=1S/C10H18N2.C6H10FN/c1-9(2)12-6-3-4-10(8-11)5-7-12;1-8-4-2-3-6(7)5-8/h9-10H,3-7H2,1-2H3;3H,2,4-5H2,1H3 |
| InChIKey | OJQZZKSOTUXZCQ-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 30.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 281.42 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 5-fluoro-1-methyl-3,6-dihydro-2H-pyridine;1-propan-2-ylazepane-4-carbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-fluoro-1-methyl-3,6-dihydro-2H-pyridine;1-propan-2-ylazepane-4-carbonitrile?
The IUPAC name of 5-fluoro-1-methyl-3,6-dihydro-2H-pyridine;1-propan-2-ylazepane-4-carbonitrile (CID 166157611) is 5-fluoro-1-methyl-3,6-dihydro-2H-pyridine;1-propan-2-ylazepane-4-carbonitrile.
What is the SMILES notation for 5-fluoro-1-methyl-3,6-dihydro-2H-pyridine;1-propan-2-ylazepane-4-carbonitrile?
The canonical SMILES for 5-fluoro-1-methyl-3,6-dihydro-2H-pyridine;1-propan-2-ylazepane-4-carbonitrile is CC(C)N1CCCC(C#N)CC1.CN1CCC=C(F)C1.
What is the InChIKey of 5-fluoro-1-methyl-3,6-dihydro-2H-pyridine;1-propan-2-ylazepane-4-carbonitrile?
The InChIKey is OJQZZKSOTUXZCQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H18N2.C6H10FN/c1-9(2)12-6-3-4-10(8-11)5-7-12;1-8-4-2-3-6(7)5-8/h9-10H,3-7H2,1-2H3;3H,2,4-5H2,1H3.
What are the key properties of 5-fluoro-1-methyl-3,6-dihydro-2H-pyridine;1-propan-2-ylazepane-4-carbonitrile?
5-fluoro-1-methyl-3,6-dihydro-2H-pyridine;1-propan-2-ylazepane-4-carbonitrile has a molecular weight of 281.42 g/mol, XLogP of 3.20, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-fluoro-1-methyl-3,6-dihydro-2H-pyridine;1-propan-2-ylazepane-4-carbonitrile is sourced from PubChem (CID 166157611), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).